Methyl acetylsalicylate
| Internal ID | 7c84467e-be6c-49eb-a616-e70f1d5e14f5 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Acylsalicylic acids and derivatives |
| IUPAC Name | methyl 2-acetyloxybenzoate |
| SMILES (Canonical) | CC(=O)OC1=CC=CC=C1C(=O)OC |
| SMILES (Isomeric) | CC(=O)OC1=CC=CC=C1C(=O)OC |
| InChI | InChI=1S/C10H10O4/c1-7(11)14-9-6-4-3-5-8(9)10(12)13-2/h3-6H,1-2H3 |
| InChI Key | ONWPLBKWMAUFGZ-UHFFFAOYSA-N |
| Popularity | 13 references in papers |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 1.50 |
| Methyl aspirin |
| Methyl acetylsalicylic acid |
| RefChem:817989 |
| Methyl acetylsalicylate |
| 580-02-9 |
| Methyl 2-Acetoxybenzoate |
| Methylrhodine |
| Methyl o-acetoxybenzoate |
| Aspirin methyl ester |
| Methyl O-acetylsalicylate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.45% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.74% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.12% | 91.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.83% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.75% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.50% | 86.33% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 84.57% | 80.00% |
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 82.86% | 90.75% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.26% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Syzygium aromaticum |
| PubChem | 68484 |
| NPASS | NPC230951 |
| ChEMBL | CHEMBL163148 |