Methyl 8-hydroxy-3-methoxy-1-methyl-9,10-dioxo-9,10-dihydroanthracene-2-carboxylate
| Internal ID | 2983ed02-862d-4e74-86df-f1ecee0ba5a7 |
| Taxonomy | Benzenoids > Anthracenes > Anthracenecarboxylic acids and derivatives > Anthracenecarboxylic acids |
| IUPAC Name | methyl 8-hydroxy-3-methoxy-1-methyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES (Canonical) | CC1=C2C(=CC(=C1C(=O)OC)OC)C(=O)C3=C(C2=O)C(=CC=C3)O |
| SMILES (Isomeric) | CC1=C2C(=CC(=C1C(=O)OC)OC)C(=O)C3=C(C2=O)C(=CC=C3)O |
| InChI | InChI=1S/C18H14O6/c1-8-13-10(7-12(23-2)14(8)18(22)24-3)16(20)9-5-4-6-11(19)15(9)17(13)21/h4-7,19H,1-3H3 |
| InChI Key | BDCYFLNKHCNXDY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 89.90 Ų |
| XlogP | 3.30 |
| DTXSID801037181 |
| Methyl 8-hydroxy-3-methoxy-1-methyl-9,10-dioxo-9,10-dihydroanthracene-2-carboxylate |
| 53254-91-4 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.48% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.07% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.44% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.94% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.93% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.92% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.36% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.30% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.24% | 86.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.52% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.49% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.87% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.81% | 89.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.51% | 90.20% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.74% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.33% | 96.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.95% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.29% | 91.19% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.23% | 91.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.05% | 96.67% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.97% | 96.00% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 80.23% | 94.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Berchemia discolor |
| PubChem | 14379527 |
| LOTUS | LTS0128942 |
| wikiData | Q104170288 |