Methyl 8-hydroxy-2-methoxy-9-oxo-9H-xanthene-1-carboxylate
| Internal ID | df66abfb-301e-4fab-aae4-398dd6fcba4e |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | methyl 8-hydroxy-2-methoxy-9-oxoxanthene-1-carboxylate |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)OC3=CC=CC(=C3C2=O)O)C(=O)OC |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)OC3=CC=CC(=C3C2=O)O)C(=O)OC |
| InChI | InChI=1S/C16H12O6/c1-20-9-6-7-11-13(14(9)16(19)21-2)15(18)12-8(17)4-3-5-10(12)22-11/h3-7,17H,1-2H3 |
| InChI Key | MEQSKFCSGPLKKJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 82.10 Ų |
| XlogP | 3.00 |
| DTXSID90558767 |
| METHYL 8-HYDROXY-2-METHOXY-9-OXO-9H-XANTHENE-1-CARBOXYLATE |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.40% | 90.20% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.30% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.24% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.89% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.66% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.34% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.29% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.37% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.51% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.28% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.06% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.54% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.23% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.52% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.13% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.36% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14309395 |
| LOTUS | LTS0059121 |
| wikiData | Q82441179 |