Methyl (7E,13E,15Z)-14,16-dibromohexadeca-7,13,15-trien-5-ynoate
| Internal ID | d7a717cf-e030-4f0e-a2ac-42862771f91b |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Fatty acid methyl esters |
| IUPAC Name | methyl (7E,13E,15Z)-14,16-dibromohexadeca-7,13,15-trien-5-ynoate |
| SMILES (Canonical) | COC(=O)CCCC#CC=CCCCCC=C(C=CBr)Br |
| SMILES (Isomeric) | COC(=O)CCCC#C/C=C/CCCC/C=C(\C=C/Br)/Br |
| InChI | InChI=1S/C17H22Br2O2/c1-21-17(20)13-11-9-7-5-3-2-4-6-8-10-12-16(19)14-15-18/h2-3,12,14-15H,4,6,8-11,13H2,1H3/b3-2+,15-14-,16-12+ |
| InChI Key | UWBYQKWMZGTEIS-CKNKBZHISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H22Br2O2 |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 417.99661 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 5.70 |
| 70147-25-0 |
| Methyl (7E,13E,15Z)-14,16-dibromohexadeca-7,13,15-trien-5-ynoate |
| RefChem:157119 |
| DTXCID70665281 |
| NSC300263 |
| NSC-300263 |
| HEXADECATRIEN-5-YNOATE, 5-DIBROMO- (B713496F013) |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.80% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.00% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.64% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.34% | 91.11% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.45% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.25% | 96.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.55% | 91.07% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.27% | 96.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.99% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.59% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.35% | 96.95% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 80.44% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 54607547 |
| LOTUS | LTS0053499 |
| wikiData | Q82651411 |