Methyl 7beta-hydroxyabieta-8,11,13-trien-18-oate
Internal ID | c14cf127-059f-47d7-b411-7c226232ba77 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl 9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
SMILES (Canonical) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2O)(C)C(=O)OC)C |
SMILES (Isomeric) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2O)(C)C(=O)OC)C |
InChI | InChI=1S/C21H30O3/c1-13(2)14-7-8-16-15(11-14)17(22)12-18-20(16,3)9-6-10-21(18,4)19(23)24-5/h7-8,11,13,17-18,22H,6,9-10,12H2,1-5H3 |
InChI Key | HWUVPJJFVCOYPE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O3 |
Molecular Weight | 330.50 g/mol |
Exact Mass | 330.21949481 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.60 |
HWUVPJJFVCOYPE-UHFFFAOYSA-N |
Methyl 7-hydroxyabieta-9(11),8(14),12-trien-18-oate # |
![2D Structure of Methyl 7beta-hydroxyabieta-8,11,13-trien-18-oate 2D Structure of Methyl 7beta-hydroxyabieta-8,11,13-trien-18-oate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-7beta-hydroxyabieta-81113-trien-18-oate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.12% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.66% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.29% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.69% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.27% | 97.25% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.39% | 91.07% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.62% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.05% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.80% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.21% | 90.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.96% | 95.93% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.18% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.07% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.18% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.87% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 82.64% | 98.75% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.28% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.95% | 86.33% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.49% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.99% | 83.82% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.99% | 91.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.34% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.04% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mikania triangularis |
PubChem | 616984 |
LOTUS | LTS0103765 |
wikiData | Q105034836 |