methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate
| Internal ID | 494c0d22-cb7c-4e33-890e-f2fd92446493 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate |
| SMILES (Canonical) | CC(C)CC(CC(C)C1CCC(=CC1)C(=O)OC)O |
| SMILES (Isomeric) | C[C@H](C[C@@H](CC(C)C)O)[C@@H]1CCC(=CC1)C(=O)OC |
| InChI | InChI=1S/C16H28O3/c1-11(2)9-15(17)10-12(3)13-5-7-14(8-6-13)16(18)19-4/h7,11-13,15,17H,5-6,8-10H2,1-4H3/t12-,13+,15-/m1/s1 |
| InChI Key | KVQQCXYORPHUQU-VNHYZAJKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.20384475 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-4r-4-2r4r-4-hydroxy-6-methylheptan-2-ylcyclohexene-1-carboxylate.jpg "2D Structure of methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.97% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.21% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.21% | 90.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.81% | 90.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.56% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.89% | 93.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.80% | 94.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.48% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.48% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.07% | 83.82% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.99% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.82% | 95.89% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 83.39% | 91.65% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.50% | 97.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.28% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.20% | 90.71% |
| CHEMBL5028 | O14672 | ADAM10 | 80.06% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abies balsamea |
| Abies sachalinensis |
| PubChem | 14396631 |
| LOTUS | LTS0140827 |
| wikiData | Q104375745 |