Methyl 4-methyl-2-(oxamoylamino)pentanoate
| Internal ID | 5d89ec4a-4be6-4641-9f56-1d2f417a9945 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | methyl 4-methyl-2-(oxamoylamino)pentanoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H16N2O4/c1-5(2)4-6(9(14)15-3)11-8(13)7(10)12/h5-6H,4H2,1-3H3,(H2,10,12)(H,11,13) |
| InChI Key | YOAIPUXWHBBNOK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11100700 g/mol |
| Topological Polar Surface Area (TPSA) | 98.50 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.73% | 96.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.71% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.00% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.53% | 98.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.68% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.58% | 94.45% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 85.11% | 92.80% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.88% | 98.05% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 83.67% | 87.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.31% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.01% | 90.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.73% | 94.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.83% | 89.63% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.47% | 94.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 81.47% | 92.29% |
| CHEMBL268 | P43235 | Cathepsin K | 81.23% | 96.85% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.15% | 96.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.95% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.87% | 96.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 80.67% | 93.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.40% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.00% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162928002 |
| LOTUS | LTS0054476 |
| wikiData | Q104201895 |