Methyl 4-Methoxyindole-3-acetate
| Internal ID | d2c50467-6915-4186-aaaa-be1a0065c95e |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolyl carboxylic acids and derivatives > Indole-3-acetic acid derivatives |
| IUPAC Name | methyl 2-(4-methoxy-1H-indol-3-yl)acetate |
| SMILES (Canonical) | COC1=CC=CC2=C1C(=CN2)CC(=O)OC |
| SMILES (Isomeric) | COC1=CC=CC2=C1C(=CN2)CC(=O)OC |
| InChI | InChI=1S/C12H13NO3/c1-15-10-5-3-4-9-12(10)8(7-13-9)6-11(14)16-2/h3-5,7,13H,6H2,1-2H3 |
| InChI Key | NWALYIKBPXGTJR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.08954328 g/mol |
| Topological Polar Surface Area (TPSA) | 51.30 Ų |
| XlogP | 1.80 |
| 142653-08-5 |
| Methyl4-Methoxyindole-3-acetate |
| AC4204 |
| MFCD15527682 |
| AKOS037629831 |
| SY058630 |
| A920921 |
| METHYL 2-(4-METHOXY-1H-INDOL-3-YL)ACETATE |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.92% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.34% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.71% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.19% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.66% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.00% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.82% | 90.20% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.12% | 96.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.60% | 85.14% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.78% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.73% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.43% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.95% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.91% | 89.62% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.65% | 95.48% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.31% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 53419525 |
| LOTUS | LTS0072529 |
| wikiData | Q105186501 |