Methyl 4-(4-hydroxy-3-methoxyphenyl)but-2-enoate
| Internal ID | c0bddcb6-2683-49fc-b4d0-a6015f48b30f |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | methyl 4-(4-hydroxy-3-methoxyphenyl)but-2-enoate |
| SMILES (Canonical) | COC1=C(C=CC(=C1)CC=CC(=O)OC)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)CC=CC(=O)OC)O |
| InChI | InChI=1S/C12H14O4/c1-15-11-8-9(6-7-10(11)13)4-3-5-12(14)16-2/h3,5-8,13H,4H2,1-2H3 |
| InChI Key | DDSRVFWTSCQXGY-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.92% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.80% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.35% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.78% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.29% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.54% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.23% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.04% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.22% | 90.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.70% | 96.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.27% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pisonia aculeata |
| PubChem | 162906583 |
| LOTUS | LTS0132029 |
| wikiData | Q104976827 |