methyl 4-[(2R,5S)-5-[(3E,11Z)-12-bromododeca-3,11-dien-1-ynyl]oxolan-2-yl]butanoate
| Internal ID | 6b35770e-34f8-47cf-830b-2452b27c4c95 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Fatty acid methyl esters |
| IUPAC Name | methyl 4-[(2R,5S)-5-[(3E,11Z)-12-bromododeca-3,11-dien-1-ynyl]oxolan-2-yl]butanoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C21H31BrO3/c1-24-21(23)15-12-14-20-17-16-19(25-20)13-10-8-6-4-2-3-5-7-9-11-18-22/h6,8,11,18-20H,2-5,7,9,12,14-17H2,1H3/b8-6+,18-11-/t19-,20-/m1/s1 |
| InChI Key | ATHZZRJFORDQAQ-FXBCZMGQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C21H31BrO3 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 410.14566 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 6.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.10% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.15% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.37% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 92.99% | 89.76% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.39% | 96.38% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.96% | 94.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.87% | 92.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.16% | 96.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.14% | 100.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.11% | 97.47% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.04% | 91.07% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.57% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.11% | 98.95% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.17% | 92.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.98% | 99.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.69% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.38% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.14% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.98% | 96.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.20% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16658854 |
| LOTUS | LTS0097067 |
| wikiData | Q104918433 |