methyl (3R,4S,6E,10R,11E)-4,10-diethyl-3-hydroxy-6-methyl-8-oxotetradeca-6,11-dienoate
| Internal ID | b852206c-bf26-40a1-b102-aae61c9c8f36 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Acyclic monoterpenoids |
| IUPAC Name | methyl (3R,4S,6E,10R,11E)-4,10-diethyl-3-hydroxy-6-methyl-8-oxotetradeca-6,11-dienoate |
| SMILES (Canonical) | CCC=CC(CC)CC(=O)C=C(C)CC(CC)C(CC(=O)OC)O |
| SMILES (Isomeric) | CC/C=C/[C@H](CC)CC(=O)/C=C(\C)/C[C@H](CC)[C@@H](CC(=O)OC)O |
| InChI | InChI=1S/C20H34O4/c1-6-9-10-16(7-2)13-18(21)12-15(4)11-17(8-3)19(22)14-20(23)24-5/h9-10,12,16-17,19,22H,6-8,11,13-14H2,1-5H3/b10-9+,15-12+/t16-,17-,19+/m0/s1 |
| InChI Key | XTEWMCMHZLQNIR-DEPBIILISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.05% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.86% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.02% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.70% | 85.14% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.26% | 94.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.88% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.85% | 97.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.09% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.58% | 97.21% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.26% | 98.59% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 84.07% | 95.93% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.01% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.05% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.99% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163045608 |
| LOTUS | LTS0130723 |
| wikiData | Q105341516 |