Methyl 3,4,6,8-tetrahydroxy-9-oxoxanthene-1-carboxylate
| Internal ID | c9d6c3e3-3b99-4cdb-a597-c108327b0409 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | methyl 3,4,6,8-tetrahydroxy-9-oxoxanthene-1-carboxylate |
| SMILES (Canonical) | COC(=O)C1=CC(=C(C2=C1C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| SMILES (Isomeric) | COC(=O)C1=CC(=C(C2=C1C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| InChI | InChI=1S/C15H10O8/c1-22-15(21)6-4-8(18)12(19)14-10(6)13(20)11-7(17)2-5(16)3-9(11)23-14/h2-4,16-19H,1H3 |
| InChI Key | UDDAUGAFICGFLE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H10O8 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.03756727 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 93.11% | 94.42% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.16% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.55% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 91.49% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.16% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.26% | 94.73% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.21% | 81.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.00% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.88% | 99.23% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.59% | 95.64% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.80% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.27% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.65% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.15% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.91% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leiothrix flavescens |
| PubChem | 12051849 |
| LOTUS | LTS0068156 |
| wikiData | Q105270308 |