Methyl 3-(4-methoxyphenoxy)propionate
| Internal ID | 2c0c9dee-e977-4e76-a5c2-3d182c13a9d2 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | methyl 3-(4-methoxyphenoxy)propanoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H14O4/c1-13-9-3-5-10(6-4-9)15-8-7-11(12)14-2/h3-6H,7-8H2,1-2H3 |
| InChI Key | AKBHVBLEQNXNQQ-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 1.70 |
| 18333-12-5 |
| Methyl 3-(4-methoxyphenoxy)propionate |
| 967KDN5MJG |
| methyl 3-p-anisoloxypropionate |
| Propionic acid, 3-(p-methoxyphenoxy)-, methyl ester |
| Propanoic acid, 3-(4-methoxyphenoxy)-, methyl ester |
| UNII-967KDN5MJG |
| SCHEMBL11233455 |
| methyl3-(4-methoxyphenoxy)propanoate |
| AKOS005205846 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.92% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.64% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.84% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.76% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.93% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.88% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.95% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.12% | 94.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.64% | 94.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.57% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 43082932 |
| LOTUS | LTS0081366 |
| wikiData | Q27271881 |