methyl (2R)-3-hydroxy-2-(4-hydroxy-3-methoxyphenyl)propanoate
| Internal ID | 3eac7da6-550c-4315-a9f8-faae3053c402 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | methyl (2R)-3-hydroxy-2-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C(CO)C(=O)OC)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@H](CO)C(=O)OC)O |
| InChI | InChI=1S/C11H14O5/c1-15-10-5-7(3-4-9(10)13)8(6-12)11(14)16-2/h3-5,8,12-13H,6H2,1-2H3/t8-/m0/s1 |
| InChI Key | ZQMCMXRXLGCJJJ-QMMMGPOBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.26% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.19% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.70% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.46% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.90% | 89.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.71% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.97% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.68% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.18% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.50% | 90.20% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.37% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.01% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.65% | 86.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.16% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.04% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pisonia umbellifera |
| PubChem | 162867207 |
| LOTUS | LTS0212164 |
| wikiData | Q105381543 |