Methyl 2-(7,8-dihydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)prop-2-enoate
Internal ID | 90fc8c0c-a6ae-4b8e-8b6b-40b36e6dc0d4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
IUPAC Name | methyl 2-(7,8-dihydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)prop-2-enoate |
SMILES (Canonical) | CC12CCC(CC1C(C(CC2)O)(C)O)C(=C)C(=O)OC |
SMILES (Isomeric) | CC12CCC(CC1C(C(CC2)O)(C)O)C(=C)C(=O)OC |
InChI | InChI=1S/C16H26O4/c1-10(14(18)20-4)11-5-7-15(2)8-6-13(17)16(3,19)12(15)9-11/h11-13,17,19H,1,5-9H2,2-4H3 |
InChI Key | MJSUJBPBSPLBBI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H26O4 |
Molecular Weight | 282.37 g/mol |
Exact Mass | 282.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 2.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.77% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.17% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.15% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.97% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.91% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.35% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.12% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.77% | 91.19% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.97% | 96.95% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 83.94% | 98.99% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.84% | 85.31% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.70% | 94.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.33% | 91.07% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.22% | 91.03% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.18% | 96.38% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.72% | 91.24% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.20% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dittrichia graveolens |
PubChem | 74390181 |
LOTUS | LTS0079677 |
wikiData | Q105165637 |