Methyl 2-(4-methoxyphenyl)-2-oxoacetate
| Internal ID | 615d816f-9be7-43d2-bdb7-a6bc4ed13455 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoyl derivatives |
| IUPAC Name | methyl 2-(4-methoxyphenyl)-2-oxoacetate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H10O4/c1-13-8-5-3-7(4-6-8)9(11)10(12)14-2/h3-6H,1-2H3 |
| InChI Key | DDRPUCDBTNWIFK-UHFFFAOYSA-N |
| Popularity | 17 references in papers |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 1.60 |
| 32766-61-3 |
| 4-Methoxy-oxo-benzeneacetic acid methyl ester |
| methyl 4-methoxybenzoylformate |
| SCHEMBL2122107 |
| AKOS006273584 |
| methyl2-(4-methoxyphenyl)-2-oxoacetate |
| AS-44210 |
| CS-0433808 |
| A10125 |
| EN300-173856 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.31% | 90.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.79% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.25% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.80% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.88% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.69% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.55% | 98.75% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.59% | 81.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.80% | 87.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.34% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3660944 |
| LOTUS | LTS0201951 |
| wikiData | Q104976747 |