methyl 2-[(3R,4R,6R)-4,6-diethyl-6-[(2E,4R,5E)-4-ethyl-2-methylocta-2,5-dienyl]dioxan-3-yl]acetate
| Internal ID | 9d84b1d4-e944-4524-913e-0767e431f51f |
| Taxonomy | Organoheterocyclic compounds > Dioxanes > 1,2-dioxanes |
| IUPAC Name | methyl 2-[(3R,4R,6R)-4,6-diethyl-6-[(2E,4R,5E)-4-ethyl-2-methylocta-2,5-dienyl]dioxan-3-yl]acetate |
| SMILES (Canonical) | CCC=CC(CC)C=C(C)CC1(CC(C(OO1)CC(=O)OC)CC)CC |
| SMILES (Isomeric) | CC/C=C/[C@@H](CC)/C=C(\C)/C[C@]1(C[C@H]([C@H](OO1)CC(=O)OC)CC)CC |
| InChI | InChI=1S/C22H38O4/c1-7-11-12-18(8-2)13-17(5)15-22(10-4)16-19(9-3)20(25-26-22)14-21(23)24-6/h11-13,18-20H,7-10,14-16H2,1-6H3/b12-11+,17-13+/t18-,19-,20-,22+/m1/s1 |
| InChI Key | SRXLLJDSYPTQNE-ZEHOMJIZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.27700969 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 6.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.14% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.11% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.30% | 91.19% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.35% | 99.17% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.56% | 96.61% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.48% | 97.21% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.18% | 94.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.79% | 85.14% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.66% | 89.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.55% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.91% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.90% | 98.59% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.62% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162911193 |
| LOTUS | LTS0096447 |
| wikiData | Q105259496 |