methyl (1S,18S,19R,20R)-18-acetyloxy-1,3,11,12,14,17,18,19,20,21-decahydroyohimban-19-carboxylate
Internal ID | 98734aaa-8d4b-4d81-9887-cb2500075079 |
Taxonomy | Alkaloids and derivatives > Corynanthean-type alkaloids |
IUPAC Name | methyl (1S,18S,19R,20R)-18-acetyloxy-1,3,11,12,14,17,18,19,20,21-decahydroyohimban-19-carboxylate |
SMILES (Canonical) | CC(=O)OC1CC=C2CN3CCC4=C(C3CC2C1C(=O)OC)NC5=CC=CC=C45 |
SMILES (Isomeric) | CC(=O)O[C@H]1CC=C2CN3CCC4=C([C@@H]3C[C@@H]2[C@H]1C(=O)OC)NC5=CC=CC=C45 |
InChI | InChI=1S/C23H26N2O4/c1-13(26)29-20-8-7-14-12-25-10-9-16-15-5-3-4-6-18(15)24-22(16)19(25)11-17(14)21(20)23(27)28-2/h3-7,17,19-21,24H,8-12H2,1-2H3/t17-,19-,20-,21+/m0/s1 |
InChI Key | ZZUKOJLMGSWLOO-ZIBCJSCZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26N2O4 |
Molecular Weight | 394.50 g/mol |
Exact Mass | 394.18925731 g/mol |
Topological Polar Surface Area (TPSA) | 71.60 Ų |
XlogP | 2.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.55% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.32% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.95% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.40% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.73% | 94.08% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.44% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 87.77% | 98.75% |
CHEMBL5028 | O14672 | ADAM10 | 87.65% | 97.50% |
CHEMBL240 | Q12809 | HERG | 87.64% | 89.76% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.03% | 98.59% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.30% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.10% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.32% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.99% | 94.00% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.59% | 91.65% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.56% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alstonia angustifolia |
PubChem | 101287855 |
LOTUS | LTS0042379 |
wikiData | Q105387090 |