methyl (1R,2S)-5-methoxy-2-methyl-7-oxocycloocta-3,5-diene-1-carboxylate
Internal ID | 039ad475-3da2-436c-b6e8-665ebd9b67fd |
Taxonomy | Organic acids and derivatives > Vinylogous esters |
IUPAC Name | methyl (1R,2S)-5-methoxy-2-methyl-7-oxocycloocta-3,5-diene-1-carboxylate |
SMILES (Canonical) | CC1C=CC(=CC(=O)CC1C(=O)OC)OC |
SMILES (Isomeric) | C[C@H]1C=CC(=CC(=O)C[C@H]1C(=O)OC)OC |
InChI | InChI=1S/C12H16O4/c1-8-4-5-10(15-2)6-9(13)7-11(8)12(14)16-3/h4-6,8,11H,7H2,1-3H3/t8-,11+/m0/s1 |
InChI Key | JJFGPKSBGIFXSO-GZMMTYOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H16O4 |
Molecular Weight | 224.25 g/mol |
Exact Mass | 224.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 52.60 Ų |
XlogP | 1.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.96% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.11% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.75% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.08% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.12% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.53% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.80% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.91% | 90.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.32% | 97.25% |
CHEMBL2535 | P11166 | Glucose transporter | 80.94% | 98.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.32% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erigeron philadelphicus |
PubChem | 162878422 |
LOTUS | LTS0100928 |
wikiData | Q66961327 |