Methyl 14,14-dibromo-6,7-dihydroxytetradeca-4,13-dienoate
| Internal ID | 51590416-af0c-48e0-b956-b4d3ef780555 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Fatty acid methyl esters |
| IUPAC Name | methyl 14,14-dibromo-6,7-dihydroxytetradeca-4,13-dienoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H24Br2O4/c1-21-15(20)11-7-6-9-13(19)12(18)8-4-2-3-5-10-14(16)17/h6,9-10,12-13,18-19H,2-5,7-8,11H2,1H3 |
| InChI Key | FFPKKWNJQCYPHB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24Br2O4 |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 428.00209 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.15% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.75% | 96.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.76% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.51% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.86% | 98.95% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.29% | 95.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.73% | 94.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.56% | 89.34% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.80% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.76% | 93.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.81% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.28% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.53% | 95.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.83% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.55% | 91.19% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.36% | 95.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.94% | 94.73% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.95% | 98.75% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.71% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75599659 |
| LOTUS | LTS0126101 |
| wikiData | Q104994613 |