Methyl 11,13-dihydroxytetracos-9-enoate
Internal ID | 06648c74-29aa-4347-a93c-d0f7930831f8 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
IUPAC Name | methyl 11,13-dihydroxytetracos-9-enoate |
SMILES (Canonical) | CCCCCCCCCCCC(CC(C=CCCCCCCCC(=O)OC)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC(CC(C=CCCCCCCCC(=O)OC)O)O |
InChI | InChI=1S/C25H48O4/c1-3-4-5-6-7-8-10-13-16-19-23(26)22-24(27)20-17-14-11-9-12-15-18-21-25(28)29-2/h17,20,23-24,26-27H,3-16,18-19,21-22H2,1-2H3 |
InChI Key | KRZGFAXNBVEHQE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H48O4 |
Molecular Weight | 412.60 g/mol |
Exact Mass | 412.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 8.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.70% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 97.04% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.41% | 96.09% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.34% | 97.29% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.07% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.96% | 92.08% |
CHEMBL240 | Q12809 | HERG | 92.87% | 89.76% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.69% | 93.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.45% | 95.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.47% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.32% | 90.17% |
CHEMBL299 | P17252 | Protein kinase C alpha | 89.13% | 98.03% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.76% | 91.81% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.16% | 89.63% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.11% | 96.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.02% | 92.86% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.00% | 89.34% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.82% | 94.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.97% | 96.47% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.94% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.34% | 96.00% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.48% | 85.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.09% | 91.19% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.06% | 100.00% |
CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 84.04% | 95.93% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 84.02% | 96.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.56% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.22% | 94.45% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.18% | 95.71% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.31% | 87.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.71% | 94.73% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.57% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Baliospermum solanifolium |
PubChem | 162886071 |
LOTUS | LTS0133724 |
wikiData | Q105145311 |