Methyl 11-hydroxy-1-methoxy-4,6-dimethyl-10-oxo-1,3-dihydrofuro[3,4-b]xanthene-3-carboxylate
| Internal ID | 4460a905-d8c8-4fb6-8b31-0628eb9e8fbf |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | methyl 11-hydroxy-1-methoxy-4,6-dimethyl-10-oxo-1,3-dihydrofuro[3,4-b]xanthene-3-carboxylate |
| SMILES (Canonical) | CC1=C2C(=CC=C1)C(=O)C3=C(O2)C(=C4C(OC(C4=C3O)OC)C(=O)OC)C |
| SMILES (Isomeric) | CC1=C2C(=CC=C1)C(=O)C3=C(O2)C(=C4C(OC(C4=C3O)OC)C(=O)OC)C |
| InChI | InChI=1S/C20H18O7/c1-8-6-5-7-10-14(21)13-15(22)12-11(9(2)17(13)26-16(8)10)18(19(23)24-3)27-20(12)25-4/h5-7,18,20,22H,1-4H3 |
| InChI Key | RSHLQJHJEKDNRR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10525291 g/mol |
| Topological Polar Surface Area (TPSA) | 91.30 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of Methyl 11-hydroxy-1-methoxy-4,6-dimethyl-10-oxo-1,3-dihydrofuro[3,4-b]xanthene-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-11-hydroxy-1-methoxy-46-dimethyl-10-oxo-13-dihydrofuro34-bxanthene-3-carboxylate.jpg "2D Structure of Methyl 11-hydroxy-1-methoxy-4,6-dimethyl-10-oxo-1,3-dihydrofuro[3,4-b]xanthene-3-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.81% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.62% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.38% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.36% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.99% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.74% | 89.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 91.46% | 93.65% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.87% | 94.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 86.79% | 83.10% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.81% | 94.45% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.53% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.03% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.29% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.53% | 92.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.30% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Boerhavia diffusa |
| PubChem | 163010963 |
| LOTUS | LTS0272261 |
| wikiData | Q105244652 |