Pyrrolomycin F1
| Internal ID | fc740a70-1a56-4dc8-b753-fd82f77d01a6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Aryl-phenylketones |
| IUPAC Name | (5-bromo-2-hydroxyphenyl)-(3,4,5-tribromo-1H-pyrrol-2-yl)methanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H5Br4NO2/c12-4-1-2-6(17)5(3-4)10(18)9-7(13)8(14)11(15)16-9/h1-3,16-17H |
| InChI Key | LTKQHGHTROTART-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C11H5Br4NO2 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.70128 g/mol |
| Topological Polar Surface Area (TPSA) | 53.10 Ų |
| XlogP | 5.70 |
| Pyrrolomycin F1 |
| Methanone, (5-bromo-2-hydroxyphenyl)(3,4,5-tribromo-1H-pyrrol-2-yl)- |
| 88217-19-0 |
| (5-Bromo-2-hydroxyphenyl)(3,4,5-tribromo-1H-pyrrol-2-yl)methanone |
| (5-bromo-2-hydroxyphenyl)-(3,4,5-tribromo-1H-pyrrol-2-yl)methanone |
| CHEMBL4075973 |
| DTXSID80236901 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.26% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.96% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.21% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.76% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.19% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.26% | 92.94% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.98% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.87% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.91% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 81.76% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.99% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3086276 |
| LOTUS | LTS0081078 |
| wikiData | Q83119010 |