Mesuagenin D
Internal ID | 9420b18c-3bec-4d83-ac17-af7cca6eac6b |
Taxonomy | Phenylpropanoids and polyketides > Neoflavonoids > Prenylated neoflavonoids |
IUPAC Name | 4-hydroxy-2-(2-hydroxy-5-methylhexan-2-yl)-2-methyl-5-(3-methylbutanoyl)-9-phenyl-3H-furo[2,3-f]chromen-7-one |
SMILES (Canonical) | CC(C)CCC(C)(C1(CC2=C(C(=C3C(=C2O1)C(=CC(=O)O3)C4=CC=CC=C4)C(=O)CC(C)C)O)C)O |
SMILES (Isomeric) | CC(C)CCC(C)(C1(CC2=C(C(=C3C(=C2O1)C(=CC(=O)O3)C4=CC=CC=C4)C(=O)CC(C)C)O)C)O |
InChI | InChI=1S/C30H36O6/c1-17(2)12-13-29(5,34)30(6)16-21-26(33)25(22(31)14-18(3)4)28-24(27(21)36-30)20(15-23(32)35-28)19-10-8-7-9-11-19/h7-11,15,17-18,33-34H,12-14,16H2,1-6H3 |
InChI Key | PABMLJMVAOFHKY-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H36O6 |
Molecular Weight | 492.60 g/mol |
Exact Mass | 492.25118886 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 6.10 |
CHEMBL1277681 |
D00FEH |
BDBM50330757 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.56% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.01% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.44% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.59% | 93.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.35% | 96.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 88.75% | 90.93% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.42% | 93.04% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.20% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.75% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.63% | 99.23% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.40% | 93.31% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.18% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.92% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.50% | 97.14% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.31% | 91.71% |
CHEMBL236 | P41143 | Delta opioid receptor | 80.71% | 99.35% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.16% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kayea elegans |
PubChem | 52945557 |
NPASS | NPC469934 |
ChEMBL | CHEMBL1277681 |
LOTUS | LTS0064565 |
wikiData | Q105204333 |