Mesembrenol
Internal ID | f3969b77-e8b2-4d83-b41b-5184710a9e14 |
Taxonomy | Organoheterocyclic compounds > Pyrrolidines > Phenylpyrrolidines |
IUPAC Name | (3aR,6S,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
SMILES (Canonical) | CN1CCC2(C1CC(C=C2)O)C3=CC(=C(C=C3)OC)OC |
SMILES (Isomeric) | CN1CC[C@]2([C@@H]1C[C@@H](C=C2)O)C3=CC(=C(C=C3)OC)OC |
InChI | InChI=1S/C17H23NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-7,10,13,16,19H,8-9,11H2,1-3H3/t13-,16+,17+/m1/s1 |
InChI Key | PQBHZMSTECYZLH-COXVUDFISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H23NO3 |
Molecular Weight | 289.40 g/mol |
Exact Mass | 289.16779360 g/mol |
Topological Polar Surface Area (TPSA) | 41.90 Ų |
XlogP | 2.30 |
25516-15-8 |
HY-124482 |
CS-0086635 |
(3aR,6S,7aS)-3a-(3,4-Dimethoxyphenyl)-1-methyl-2,3,3a,6,7,7a-hexahydro-1H-indol-6-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.21% | 96.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.51% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.31% | 90.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.58% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.54% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.72% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.76% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.66% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.33% | 95.56% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.34% | 91.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.18% | 91.07% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.07% | 89.50% |
CHEMBL2581 | P07339 | Cathepsin D | 83.65% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.15% | 97.14% |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 82.01% | 94.05% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.10% | 90.24% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.08% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mesembryanthemum ladismithiense |
PubChem | 139262238 |
LOTUS | LTS0255593 |
wikiData | Q105213139 |