Memnopeptide A
| Internal ID | c0ea77fc-f219-4bbb-b7cd-c45af0ece25a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 1-[1-[2-[[1-[2-[[2-[[1-[2-[[2-[[2-[(3R,4aS,7R,8R,8aS)-3,4'-dihydroxy-4,4,7,8a-tetramethyl-6'-oxospiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3,8-dihydrofuro[2,3-e]isoindole]-7'-yl]-4-methylsulfinylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-amino-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-amino-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CC1CCC2C(C(CCC2(C13CC4=C(C=C5C(=C4O3)CN(C5=O)C(CCS(=O)C)C(=O)NC(CC6=CN=CN6)C(=O)NC(CCC(=O)N)C(=O)N7CCCC7C(=O)NC(CC8=CN=CN8)C(=O)NC(CCC(=O)N)C(=O)N9CCCC9C(=O)NC(CC(C)C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)O)O)C)O)(C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)CN(C5=O)C(CCS(=O)C)C(=O)NC(CC6=CN=CN6)C(=O)NC(CCC(=O)N)C(=O)N7CCCC7C(=O)NC(CC8=CN=CN8)C(=O)NC(CCC(=O)N)C(=O)N9CCCC9C(=O)NC(CC(C)C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)O)O)(CC[C@H](C2(C)C)O)C |
| InChI | InChI=1S/C76H108N16O18S/c1-40(2)30-51(71(105)90-27-10-14-55(90)72(106)91-28-11-15-56(91)73(107)108)87-66(100)53-13-9-26-89(53)70(104)48(18-21-61(78)96)83-63(97)49(31-42-35-79-38-81-42)85-65(99)52-12-8-25-88(52)69(103)47(17-20-60(77)95)84-64(98)50(32-43-36-80-39-82-43)86-67(101)54(23-29-111(7)109)92-37-46-44(68(92)102)33-57(93)45-34-76(110-62(45)46)41(3)16-19-58-74(4,5)59(94)22-24-75(58,76)6/h33,35-36,38-41,47-56,58-59,93-94H,8-32,34,37H2,1-7H3,(H2,77,95)(H2,78,96)(H,79,81)(H,80,82)(H,83,97)(H,84,98)(H,85,99)(H,86,101)(H,87,100)(H,107,108)/t41-,47?,48?,49?,50?,51?,52?,53?,54?,55?,56?,58+,59-,75+,76-,111?/m1/s1 |
| InChI Key | GRBLBISGALXJDT-LHTGWLQBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C76H108N16O18S |
| Molecular Weight | 1565.80 g/mol |
| Exact Mass | 1564.77482183 g/mol |
| Topological Polar Surface Area (TPSA) | 514.00 Ų |
| XlogP | 0.50 |
| Atomic LogP (AlogP) | 0.37 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 12 |
| Rotatable Bonds | 31 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8612 | 86.12% |
| Caco-2 | - | 0.8611 | 86.11% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Lysosomes | 0.5057 | 50.57% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7947 | 79.47% |
| OATP1B3 inhibitior | + | 0.9209 | 92.09% |
| MATE1 inhibitior | - | 0.8455 | 84.55% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9808 | 98.08% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8509 | 85.09% |
| CYP3A4 substrate | + | 0.7565 | 75.65% |
| CYP2C9 substrate | - | 0.8049 | 80.49% |
| CYP2D6 substrate | - | 0.8484 | 84.84% |
| CYP3A4 inhibition | + | 0.5000 | 50.00% |
| CYP2C9 inhibition | - | 0.7224 | 72.24% |
| CYP2C19 inhibition | - | 0.7334 | 73.34% |
| CYP2D6 inhibition | - | 0.8419 | 84.19% |
| CYP1A2 inhibition | - | 0.7747 | 77.47% |
| CYP2C8 inhibition | + | 0.8352 | 83.52% |
| CYP inhibitory promiscuity | - | 0.8414 | 84.14% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7200 | 72.00% |
| Carcinogenicity (trinary) | Non-required | 0.5934 | 59.34% |
| Eye corrosion | - | 0.9830 | 98.30% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7679 | 76.79% |
| Skin corrosion | - | 0.9206 | 92.06% |
| Ames mutagenesis | - | 0.6037 | 60.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7061 | 70.61% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.5594 | 55.94% |
| skin sensitisation | - | 0.8509 | 85.09% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | - | 0.9358 | 93.58% |
| Acute Oral Toxicity (c) | III | 0.5849 | 58.49% |
| Estrogen receptor binding | - | 0.6143 | 61.43% |
| Androgen receptor binding | + | 0.7693 | 76.93% |
| Thyroid receptor binding | + | 0.8183 | 81.83% |
| Glucocorticoid receptor binding | + | 0.8469 | 84.69% |
| Aromatase binding | + | 0.8235 | 82.35% |
| PPAR gamma | + | 0.7626 | 76.26% |
| Honey bee toxicity | - | 0.6306 | 63.06% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.9544 | 95.44% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.67% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.38% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 99.04% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.33% | 98.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.47% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.16% | 93.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.14% | 97.64% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.66% | 96.61% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.64% | 90.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.54% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.43% | 90.20% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.23% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.89% | 95.38% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.64% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.24% | 95.89% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.12% | 92.88% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 93.85% | 88.84% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.44% | 96.21% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 93.03% | 97.53% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 92.99% | 96.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.64% | 100.00% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 91.70% | 92.86% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.27% | 95.56% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 90.98% | 98.10% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 90.70% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.90% | 99.23% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.80% | 95.56% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.73% | 100.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 89.05% | 99.17% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.81% | 94.50% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.75% | 93.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.65% | 96.90% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 88.40% | 88.42% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 88.16% | 92.38% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.04% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.91% | 93.10% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.53% | 99.15% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 86.05% | 99.23% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 85.84% | 96.33% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 85.60% | 96.76% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.39% | 94.78% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.21% | 91.19% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 84.71% | 98.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.50% | 93.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.12% | 97.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.03% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.97% | 90.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.47% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.81% | 89.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.40% | 92.98% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.38% | 90.24% |
| CHEMBL5028 | O14672 | ADAM10 | 82.06% | 97.50% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.90% | 96.38% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 81.74% | 91.81% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 81.21% | 95.12% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.13% | 91.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.79% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.72% | 95.00% |
| CHEMBL1628481 | P35414 | Apelin receptor | 80.58% | 97.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.22% | 97.25% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 80.04% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585138 |
| LOTUS | LTS0043314 |
| wikiData | Q77384685 |