Melithiazol K
| Internal ID | 8a2b7525-bfa1-4a05-99b0-6e4ec83a4085 |
| Taxonomy | Organoheterocyclic compounds > Azoles > Thiazoles > 2,4-disubstituted thiazoles |
| IUPAC Name | methyl (2E,6E)-3,5-dimethoxy-4-methyl-7-[2-[2-(2-methyloxiran-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienoate |
| SMILES (Canonical) | CC(C(C=CC1=CSC(=N1)C2CSC(=N2)C3(CO3)C)OC)C(=CC(=O)OC)OC |
| SMILES (Isomeric) | CC(C(/C=C/C1=CSC(=N1)C2CSC(=N2)C3(CO3)C)OC)/C(=C\C(=O)OC)/OC |
| InChI | InChI=1S/C20H26N2O5S2/c1-12(16(25-4)8-17(23)26-5)15(24-3)7-6-13-9-28-18(21-13)14-10-29-19(22-14)20(2)11-27-20/h6-9,12,14-15H,10-11H2,1-5H3/b7-6+,16-8+ |
| InChI Key | ZJXYLBWVBXQTFS-QICXOPSUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.12831428 g/mol |
| Topological Polar Surface Area (TPSA) | 136.00 Ų |
| XlogP | 2.00 |
| methyl (2E,6E)-3,5-dimethoxy-4-methyl-7-[2-[2-(2-methyloxiran-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienoate |
| methyl (2E,6E)-3,5-dimethoxy-4-methyl-7-(2-(2-(2-methyloxiran-2-yl)-4,5-dihydro-1,3-thiazol-4-yl)-1,3-thiazol-4-yl)hepta-2,6-dienoate |
| Methyl (2E,6E)-3,5-dimethoxy-4-methyl-7-(2-(2-(2-methyloxiran-2-yl)-4,5-dihydro-1,3-thiazol-4-yl)-1,3-thiazol-4-yl)hepta-2,6-dienoic acid |
| Methyl (2E,6E)-3,5-dimethoxy-4-methyl-7-{2-[2-(2-methyloxiran-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl}hepta-2,6-dienoic acid |
| RefChem:156387 |
| CHEBI:199956 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.59% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.37% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.72% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.76% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.49% | 94.45% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.45% | 95.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.69% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.96% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.03% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.79% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.32% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.86% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.85% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.47% | 92.62% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.84% | 97.53% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.39% | 93.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.21% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10550996 |
| LOTUS | LTS0081460 |
| wikiData | Q75068619 |