Meliasenin O
Internal ID | cad1917d-1f48-472b-9aa4-255e9b27f5de |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,4S,7R,8S,9S,12R,13R,18R)-7-[(3R)-3-hydroperoxy-4-methylpent-4-enyl]-2,9,13,17,17-pentamethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione |
SMILES (Canonical) | CC(=C)C(CCC1C2C(CC3(C2(CCC4C3=CCC5C4(CCC(=O)C5(C)C)C)C)C)OC1=O)OO |
SMILES (Isomeric) | CC(=C)[C@@H](CC[C@@H]1[C@@H]2[C@H](C[C@]3([C@]2(CC[C@H]4C3=CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)C)OC1=O)OO |
InChI | InChI=1S/C30H44O5/c1-17(2)21(35-33)10-8-18-25-22(34-26(18)32)16-30(7)20-9-11-23-27(3,4)24(31)13-14-28(23,5)19(20)12-15-29(25,30)6/h9,18-19,21-23,25,33H,1,8,10-16H2,2-7H3/t18-,19+,21-,22+,23+,25-,28-,29+,30-/m1/s1 |
InChI Key | HASDXLPYERWHOW-STBDDEOLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H44O5 |
Molecular Weight | 484.70 g/mol |
Exact Mass | 484.31887450 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 5.90 |
CHEBI:70523 |
CHEMBL1641923 |
Q27138854 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.55% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.78% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.95% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.88% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.62% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.31% | 82.69% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.89% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.72% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.69% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.92% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.84% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.57% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.46% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 81.67% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.78% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 50900242 |
LOTUS | LTS0085600 |
wikiData | Q27138854 |