Meliasenin M, (rel)-
Internal ID | 0b16166a-d03b-4979-b291-af284f004666 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,4S,7R,8S,9S,12R,13R,18R)-7-[(E)-4-hydroperoxy-4-methylpent-2-enyl]-2,9,13,17,17-pentamethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione |
SMILES (Canonical) | CC1(C2CC=C3C(C2(CCC1=O)C)CCC4(C3(CC5C4C(C(=O)O5)CC=CC(C)(C)OO)C)C)C |
SMILES (Isomeric) | C[C@]12CCC(=O)C([C@@H]1CC=C3[C@@H]2CC[C@@]4([C@@]3(C[C@H]5[C@H]4[C@H](C(=O)O5)C/C=C/C(C)(C)OO)C)C)(C)C |
InChI | InChI=1S/C30H44O5/c1-26(2,35-33)14-8-9-18-24-21(34-25(18)32)17-30(7)20-10-11-22-27(3,4)23(31)13-15-28(22,5)19(20)12-16-29(24,30)6/h8,10,14,18-19,21-22,24,33H,9,11-13,15-17H2,1-7H3/b14-8+/t18-,19+,21+,22+,24-,28-,29+,30-/m1/s1 |
InChI Key | LQPSEQWINGOYLK-UHVZVPEASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H44O5 |
Molecular Weight | 484.70 g/mol |
Exact Mass | 484.31887450 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 5.30 |
CHEBI:70521 |
Meliasenin M |
CHEMBL1641921 |
Q27138852 |
![2D Structure of Meliasenin M, (rel)- 2D Structure of Meliasenin M, (rel)-](https://plantaedb.com/storage/docs/compounds/2023/11/meliasenin-m-rel-.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.13% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.49% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.35% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.54% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.51% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.60% | 95.56% |
CHEMBL204 | P00734 | Thrombin | 91.21% | 96.01% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.28% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.22% | 97.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.60% | 89.34% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.65% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.77% | 92.62% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.83% | 91.07% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.36% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.34% | 95.89% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.28% | 98.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.79% | 94.00% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.26% | 97.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 50900151 |
LOTUS | LTS0070866 |
wikiData | Q27138852 |