Melanostatin
| Internal ID | adaa8ae9-330d-4e95-88a4-34a5c382d33a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S)-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H24N4O3/c1-8(2)6-10(12(19)16-7-11(14)18)17-13(20)9-4-3-5-15-9/h8-10,15H,3-7H2,1-2H3,(H2,14,18)(H,16,19)(H,17,20)/t9-,10-/m0/s1 |
| InChI Key | NOOJLZTTWSNHOX-UWVGGRQHSA-N |
| Popularity | 647 references in papers |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.18484064 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -1.40 |
| Atomic LogP (AlogP) | -1.13 |
| H-Bond Acceptor | 4 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 7 |
| MELANOSTATIN |
| MIF-1 |
| Oxytocin C-terminal tripeptide |
| L-Prolyl-L-leucylglycinamide |
| MIF-I |
| 7-9-Oxytocin |
| Melanostatin I (ox) |
| (S)-N-((S)-1-((2-Amino-2-oxoethyl)amino)-4-methyl-1-oxopentan-2-yl)pyrrolidine-2-carboxamide |
| Pro-Leu-Gly amide |
| Prolylleucylglycine amide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9712 | 97.12% |
| Caco-2 | - | 0.7751 | 77.51% |
| Blood Brain Barrier | - | 0.5000 | 50.00% |
| Human oral bioavailability | + | 0.6714 | 67.14% |
| Subcellular localzation | Lysosomes | 0.4588 | 45.88% |
| OATP2B1 inhibitior | - | 0.8511 | 85.11% |
| OATP1B1 inhibitior | + | 0.9535 | 95.35% |
| OATP1B3 inhibitior | + | 0.9503 | 95.03% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | - | 0.8555 | 85.55% |
| P-glycoprotein inhibitior | - | 0.8037 | 80.37% |
| P-glycoprotein substrate | + | 0.7266 | 72.66% |
| CYP3A4 substrate | + | 0.5394 | 53.94% |
| CYP2C9 substrate | - | 0.8054 | 80.54% |
| CYP2D6 substrate | - | 0.7673 | 76.73% |
| CYP3A4 inhibition | - | 0.9741 | 97.41% |
| CYP2C9 inhibition | - | 0.9281 | 92.81% |
| CYP2C19 inhibition | - | 0.8329 | 83.29% |
| CYP2D6 inhibition | - | 0.9417 | 94.17% |
| CYP1A2 inhibition | - | 0.9147 | 91.47% |
| CYP2C8 inhibition | - | 0.9398 | 93.98% |
| CYP inhibitory promiscuity | - | 0.9825 | 98.25% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.6653 | 66.53% |
| Eye corrosion | - | 0.9593 | 95.93% |
| Eye irritation | - | 0.9914 | 99.14% |
| Skin irritation | - | 0.8000 | 80.00% |
| Skin corrosion | - | 0.8808 | 88.08% |
| Ames mutagenesis | - | 0.8000 | 80.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6131 | 61.31% |
| Micronuclear | - | 0.5500 | 55.00% |
| Hepatotoxicity | + | 0.6000 | 60.00% |
| skin sensitisation | - | 0.9218 | 92.18% |
| Respiratory toxicity | + | 0.6667 | 66.67% |
| Reproductive toxicity | + | 0.7262 | 72.62% |
| Mitochondrial toxicity | - | 0.5000 | 50.00% |
| Nephrotoxicity | - | 0.8653 | 86.53% |
| Acute Oral Toxicity (c) | III | 0.7314 | 73.14% |
| Estrogen receptor binding | - | 0.4762 | 47.62% |
| Androgen receptor binding | - | 0.6395 | 63.95% |
| Thyroid receptor binding | - | 0.5133 | 51.33% |
| Glucocorticoid receptor binding | + | 0.6450 | 64.50% |
| Aromatase binding | - | 0.6932 | 69.32% |
| PPAR gamma | + | 0.5818 | 58.18% |
| Honey bee toxicity | - | 0.9426 | 94.26% |
| Biodegradation | - | 0.6750 | 67.50% |
| Crustacea aquatic toxicity | - | 0.8100 | 81.00% |
| Fish aquatic toxicity | - | 0.8301 | 83.01% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.79% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.45% | 97.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.92% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.87% | 96.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 96.23% | 83.10% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.75% | 97.25% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 95.60% | 95.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.45% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.35% | 98.05% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.13% | 96.47% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.08% | 83.82% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.73% | 98.24% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 93.42% | 98.10% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.19% | 90.08% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.63% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.78% | 90.17% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.33% | 96.21% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.26% | 97.21% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.53% | 94.45% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 88.86% | 96.67% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.09% | 96.67% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.63% | 96.95% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.10% | 89.33% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.40% | 98.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.30% | 91.19% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.14% | 88.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.01% | 90.71% |
| CHEMBL1801 | P00747 | Plasminogen | 85.88% | 92.44% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.68% | 94.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.66% | 97.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.30% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.00% | 96.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.55% | 97.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.20% | 91.11% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.18% | 95.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.16% | 93.03% |
| CHEMBL5028 | O14672 | ADAM10 | 83.06% | 97.50% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.01% | 97.64% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.83% | 95.56% |
| CHEMBL268 | P43235 | Cathepsin K | 82.36% | 96.85% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.20% | 97.47% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.19% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.60% | 95.50% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 81.22% | 98.57% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.10% | 89.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.78% | 100.00% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 80.42% | 94.36% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.34% | 90.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.14% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 92910 |
| LOTUS | LTS0036188 |
| wikiData | Q6811443 |