Me-bAla(2S-OH,3S-heptyl)-Tyr-N(Me)Val-N(Me)Tyr-Pro-DL-Tyr-OH
| Internal ID | e64d77bd-08d5-4805-b392-9ffa62ece7e7 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CCCCCCCC(C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N(C)C(C(C)C)C(=O)N(C)C(CC2=CC=C(C=C2)O)C(=O)N3CCCC3C(=O)NC(CC4=CC=C(C=C4)O)C(=O)O)O)NC |
| SMILES (Isomeric) | CCCCCCC[C@@H]([C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](CC2=CC=C(C=C2)O)C(=O)N3CCC[C@H]3C(=O)NC(CC4=CC=C(C=C4)O)C(=O)O)O)NC |
| InChI | InChI=1S/C50H70N6O11/c1-7-8-9-10-11-13-38(51-4)44(60)46(62)52-39(28-32-15-21-35(57)22-16-32)47(63)55(6)43(31(2)3)49(65)54(5)42(30-34-19-25-37(59)26-20-34)48(64)56-27-12-14-41(56)45(61)53-40(50(66)67)29-33-17-23-36(58)24-18-33/h15-26,31,38-44,51,57-60H,7-14,27-30H2,1-6H3,(H,52,62)(H,53,61)(H,66,67)/t38-,39-,40?,41-,42-,43-,44-/m0/s1 |
| InChI Key | DHZQUBRGHKSKJI-CXMLKSNZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H70N6O11 |
| Molecular Weight | 931.10 g/mol |
| Exact Mass | 930.51025707 g/mol |
| Topological Polar Surface Area (TPSA) | 249.00 Ų |
| XlogP | 4.00 |
| Atomic LogP (AlogP) | 3.50 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 25 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5101 | 51.01% |
| Caco-2 | - | 0.8679 | 86.79% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.6557 | 65.57% |
| OATP2B1 inhibitior | - | 0.8559 | 85.59% |
| OATP1B1 inhibitior | + | 0.8441 | 84.41% |
| OATP1B3 inhibitior | + | 0.9081 | 90.81% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9703 | 97.03% |
| P-glycoprotein inhibitior | + | 0.7480 | 74.80% |
| P-glycoprotein substrate | + | 0.8350 | 83.50% |
| CYP3A4 substrate | + | 0.7234 | 72.34% |
| CYP2C9 substrate | - | 0.6006 | 60.06% |
| CYP2D6 substrate | - | 0.7435 | 74.35% |
| CYP3A4 inhibition | + | 0.5769 | 57.69% |
| CYP2C9 inhibition | - | 0.7652 | 76.52% |
| CYP2C19 inhibition | - | 0.8047 | 80.47% |
| CYP2D6 inhibition | - | 0.8562 | 85.62% |
| CYP1A2 inhibition | - | 0.9316 | 93.16% |
| CYP2C8 inhibition | + | 0.5676 | 56.76% |
| CYP inhibitory promiscuity | - | 0.8237 | 82.37% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9200 | 92.00% |
| Carcinogenicity (trinary) | Non-required | 0.6841 | 68.41% |
| Eye corrosion | - | 0.9907 | 99.07% |
| Eye irritation | - | 0.9052 | 90.52% |
| Skin irritation | - | 0.7898 | 78.98% |
| Skin corrosion | - | 0.9320 | 93.20% |
| Ames mutagenesis | - | 0.8400 | 84.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3674 | 36.74% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.5889 | 58.89% |
| skin sensitisation | - | 0.8908 | 89.08% |
| Respiratory toxicity | + | 0.7333 | 73.33% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.7322 | 73.22% |
| Acute Oral Toxicity (c) | III | 0.6741 | 67.41% |
| Estrogen receptor binding | + | 0.8494 | 84.94% |
| Androgen receptor binding | + | 0.7197 | 71.97% |
| Thyroid receptor binding | + | 0.5782 | 57.82% |
| Glucocorticoid receptor binding | + | 0.6186 | 61.86% |
| Aromatase binding | + | 0.5557 | 55.57% |
| PPAR gamma | + | 0.7987 | 79.87% |
| Honey bee toxicity | - | 0.8112 | 81.12% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5475 | 54.75% |
| Fish aquatic toxicity | + | 0.9871 | 98.71% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.44% | 96.61% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.22% | 100.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.00% | 89.63% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.60% | 98.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.54% | 93.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.01% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.40% | 99.17% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 96.11% | 96.67% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.56% | 95.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.82% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.66% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.04% | 100.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.86% | 98.24% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.83% | 92.86% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.71% | 91.81% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.24% | 90.71% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.26% | 98.10% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.07% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.53% | 95.89% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 91.29% | 97.79% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.68% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.49% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.83% | 97.14% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.73% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.56% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.56% | 97.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.28% | 95.56% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.55% | 97.93% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.49% | 90.20% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 88.46% | 92.86% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.81% | 94.66% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 87.14% | 95.52% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.70% | 95.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 86.50% | 99.35% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.46% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.17% | 94.45% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 85.47% | 92.12% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.01% | 97.29% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.38% | 97.09% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.08% | 96.37% |
| CHEMBL268 | P43235 | Cathepsin K | 83.57% | 96.85% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.50% | 94.33% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.29% | 82.38% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 82.25% | 92.22% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 81.16% | 91.76% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.84% | 97.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.72% | 93.99% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.28% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163194728 |
| LOTUS | LTS0189734 |
| wikiData | Q104203184 |