Mayfoline
Internal ID | d8f4d5b1-4856-41c7-922d-f5da3bd3f72d |
Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
IUPAC Name | (2S)-9-hydroxy-2-phenyl-1,5,9-triazacyclotridecan-4-one |
SMILES (Canonical) | C1CCN(CCCNC(=O)CC(NC1)C2=CC=CC=C2)O |
SMILES (Isomeric) | C1CCN(CCCNC(=O)C[C@H](NC1)C2=CC=CC=C2)O |
InChI | InChI=1S/C16H25N3O2/c20-16-13-15(14-7-2-1-3-8-14)17-9-4-5-11-19(21)12-6-10-18-16/h1-3,7-8,15,17,21H,4-6,9-13H2,(H,18,20)/t15-/m0/s1 |
InChI Key | QGMXLNCOBCGXMO-HNNXBMFYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H25N3O2 |
Molecular Weight | 291.39 g/mol |
Exact Mass | 291.19467705 g/mol |
Topological Polar Surface Area (TPSA) | 64.60 Ų |
XlogP | 1.00 |
NSC370988 |
74133-16-7 |
CHEMBL1988134 |
DTXSID30321159 |
NSC-370988 |
NCI60_003416 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.83% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.14% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.70% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.02% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.67% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.99% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.56% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.39% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.47% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.88% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.26% | 93.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.63% | 96.39% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.89% | 95.89% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.19% | 92.97% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.28% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maytenus buxifolia |
PubChem | 340416 |
LOTUS | LTS0121223 |
wikiData | Q82078914 |