(2S)-2-acetamido-3-[(4S,5S)-4-[[(3S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]diazinane-3-carbonyl]amino]-5-methyl-3-oxoheptyl]sulfanylpropanoic acid
| Internal ID | c5ca73e2-e5d8-41c0-99e8-a4fb83a56cc4 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids |
| IUPAC Name | (2S)-2-acetamido-3-[(4S,5S)-4-[[(3S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]diazinane-3-carbonyl]amino]-5-methyl-3-oxoheptyl]sulfanylpropanoic acid |
| SMILES (Canonical) | CCCCCC(CC(=O)NO)C(=O)N1C(CCCN1)C(=O)NC(C(C)CC)C(=O)CCSCC(C(=O)O)NC(=O)C |
| SMILES (Isomeric) | CCCCC[C@H](CC(=O)NO)C(=O)N1[C@@H](CCCN1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)CCSC[C@H](C(=O)O)NC(=O)C |
| InChI | InChI=1S/C27H47N5O8S/c1-5-7-8-10-19(15-23(35)31-40)26(37)32-21(11-9-13-28-32)25(36)30-24(17(3)6-2)22(34)12-14-41-16-20(27(38)39)29-18(4)33/h17,19-21,24,28,40H,5-16H2,1-4H3,(H,29,33)(H,30,36)(H,31,35)(H,38,39)/t17-,19+,20+,21-,24-/m0/s1 |
| InChI Key | FKOLSKSZEQBBHL-DXGKXZIESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H47N5O8S |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.31453465 g/mol |
| Topological Polar Surface Area (TPSA) | 220.00 Ų |
| XlogP | -0.70 |
| Atomic LogP (AlogP) | 1.39 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 19 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7207 | 72.07% |
| Caco-2 | - | 0.8414 | 84.14% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.6711 | 67.11% |
| OATP2B1 inhibitior | - | 0.5628 | 56.28% |
| OATP1B1 inhibitior | + | 0.8423 | 84.23% |
| OATP1B3 inhibitior | + | 0.9289 | 92.89% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.6498 | 64.98% |
| P-glycoprotein inhibitior | + | 0.6663 | 66.63% |
| P-glycoprotein substrate | + | 0.7595 | 75.95% |
| CYP3A4 substrate | + | 0.6935 | 69.35% |
| CYP2C9 substrate | + | 0.5928 | 59.28% |
| CYP2D6 substrate | - | 0.8651 | 86.51% |
| CYP3A4 inhibition | - | 0.8109 | 81.09% |
| CYP2C9 inhibition | - | 0.7904 | 79.04% |
| CYP2C19 inhibition | - | 0.7886 | 78.86% |
| CYP2D6 inhibition | - | 0.8750 | 87.50% |
| CYP1A2 inhibition | - | 0.8535 | 85.35% |
| CYP2C8 inhibition | - | 0.5608 | 56.08% |
| CYP inhibitory promiscuity | - | 0.9934 | 99.34% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.6800 | 68.00% |
| Carcinogenicity (trinary) | Non-required | 0.4922 | 49.22% |
| Eye corrosion | - | 0.9801 | 98.01% |
| Eye irritation | - | 0.9285 | 92.85% |
| Skin irritation | - | 0.7672 | 76.72% |
| Skin corrosion | - | 0.9259 | 92.59% |
| Ames mutagenesis | - | 0.6900 | 69.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6406 | 64.06% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | + | 0.5926 | 59.26% |
| skin sensitisation | - | 0.8375 | 83.75% |
| Respiratory toxicity | + | 0.6111 | 61.11% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | + | 0.9250 | 92.50% |
| Nephrotoxicity | + | 0.4541 | 45.41% |
| Acute Oral Toxicity (c) | III | 0.6073 | 60.73% |
| Estrogen receptor binding | + | 0.7351 | 73.51% |
| Androgen receptor binding | + | 0.6383 | 63.83% |
| Thyroid receptor binding | - | 0.4908 | 49.08% |
| Glucocorticoid receptor binding | + | 0.5723 | 57.23% |
| Aromatase binding | + | 0.6566 | 65.66% |
| PPAR gamma | + | 0.5585 | 55.85% |
| Honey bee toxicity | - | 0.8379 | 83.79% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.5590 | 55.90% |
| Fish aquatic toxicity | + | 0.6521 | 65.21% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.71% | 98.95% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 99.46% | 92.12% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 99.07% | 97.29% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.93% | 94.66% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.38% | 97.25% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 97.78% | 94.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.49% | 93.56% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 97.30% | 96.31% |
| CHEMBL4801 | P29466 | Caspase-1 | 96.40% | 96.85% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.39% | 96.09% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 96.26% | 97.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.05% | 91.19% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.98% | 99.17% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 94.68% | 96.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.47% | 98.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.42% | 100.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 94.03% | 97.06% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.95% | 97.21% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.91% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.84% | 90.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.55% | 100.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.80% | 97.64% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.68% | 97.29% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.25% | 97.09% |
| CHEMBL1865 | Q9UBN7 | Histone deacetylase 6 | 91.19% | 97.03% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.07% | 90.08% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 89.75% | 97.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.62% | 94.45% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.38% | 98.24% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 88.91% | 95.93% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.81% | 95.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.72% | 100.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.33% | 97.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.22% | 91.81% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.81% | 92.88% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.81% | 92.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.55% | 96.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.94% | 96.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.89% | 95.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.60% | 89.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.38% | 92.86% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.93% | 97.86% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.74% | 100.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.71% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.58% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.39% | 99.23% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.15% | 95.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.05% | 94.33% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.22% | 95.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.85% | 97.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.98% | 91.11% |
| CHEMBL5028 | O14672 | ADAM10 | 82.66% | 97.50% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.61% | 89.63% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.96% | 98.03% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 80.35% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101677001 |
| LOTUS | LTS0236359 |
| wikiData | Q104996719 |