Massetolide F
| Internal ID | 95260c2c-d6f1-4ffc-902c-4b6e99d6527d |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (4R)-5-[[(3S,6R,9S,12R,15S,18R,21R)-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]amino]-4-[[(2S)-2-[[(3S)-3-hydroxydecanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)C)CC(C)C)CO)CC(C)C)CO)CC(C)C)C)O |
| SMILES (Isomeric) | CCCCCCC[C@@H](CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@@H]1C(OC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC1=O)C(C)C)CC(C)C)CO)CC(C)C)CO)CC(C)C)C)O |
| InChI | InChI=1S/C54H95N9O16/c1-13-14-15-16-17-18-34(66)25-42(67)55-36(21-28(2)3)47(71)56-35(19-20-43(68)69)46(70)63-45-33(12)79-54(78)39(24-31(8)9)59-51(75)41(27-65)61-48(72)37(22-29(4)5)57-50(74)40(26-64)60-49(73)38(23-30(6)7)58-52(76)44(32(10)11)62-53(45)77/h28-41,44-45,64-66H,13-27H2,1-12H3,(H,55,67)(H,56,71)(H,57,74)(H,58,76)(H,59,75)(H,60,73)(H,61,72)(H,62,77)(H,63,70)(H,68,69)/t33?,34-,35+,36-,37-,38-,39-,40+,41+,44+,45+/m0/s1 |
| InChI Key | DSYOCLWRCTWQOY-KEARXTDGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C54H95N9O16 |
| Molecular Weight | 1126.40 g/mol |
| Exact Mass | 1125.68967798 g/mol |
| Topological Polar Surface Area (TPSA) | 386.00 Ų |
| XlogP | 5.10 |
| Atomic LogP (AlogP) | 0.10 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 27 |
| (4R)-5-[[(3S,6R,9S,12R,15S,18R,21R)-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]amino]-4-[[(2S)-2-[[(3S)-3-hydroxydecanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| (4R)-4-(((2S)-2-(((3S)-1,3-dihydroxydecylidene)amino)-1-hydroxy-4-methylpentylidene)amino)-4-(((3S,6R,9S,12R,15S,18R,21R)-5,8,11,14,17,20-hexahydroxy-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2-oxo-18-(propan-2-yl)-1-oxa-4,7,10,13,16,19-hexaazacyclodocosa-4,7,10,13,16,19-hexaen-21-yl)-C-hydroxycarbonimidoyl)butanoate |
| (4R)-4-{[(2S)-2-{[(3S)-1,3-dihydroxydecylidene]amino}-1-hydroxy-4-methylpentylidene]amino}-4-{[(3S,6R,9S,12R,15S,18R,21R)-5,8,11,14,17,20-hexahydroxy-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2-oxo-18-(propan-2-yl)-1-oxa-4,7,10,13,16,19-hexaazacyclodocosa-4,7,10,13,16,19-hexaen-21-yl]-C-hydroxycarbonimidoyl}butanoate |
| (4R)-5-(((3S,6R,9S,12R,15S,18R,21R)-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl)amino)-4-(((2S)-2-(((3S)-3-hydroxydecanoyl)amino)-4-methylpentanoyl)amino)-5-oxopentanoic acid |
| (4R)-5-(((3S,6R,9S,12R,15S,18R,21R,22R)-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl)amino)-4-(((2S)-2-(((3R)-3-hydroxydecanoyl)amino)-4-methylpentanoyl)amino)-5-oxopentanoic acid |
| (4R)-5-[[(3S,6R,9S,12R,15S,18R,21R,22R)-6,12-bis(hydroxymethyl)-22-methyl-3,9,15-tris(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]amino]-4-[[(2S)-2-[[(3R)-3-hydroxydecanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| RefChem:155956 |
| 186409-64-3 |
| Mabetaetolide F |
| SCHEMBL29678018 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5058 | 50.58% |
| Caco-2 | - | 0.8596 | 85.96% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.5577 | 55.77% |
| OATP2B1 inhibitior | - | 0.8631 | 86.31% |
| OATP1B1 inhibitior | + | 0.8133 | 81.33% |
| OATP1B3 inhibitior | + | 0.8899 | 88.99% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9275 | 92.75% |
| P-glycoprotein inhibitior | + | 0.7387 | 73.87% |
| P-glycoprotein substrate | + | 0.8722 | 87.22% |
| CYP3A4 substrate | + | 0.6898 | 68.98% |
| CYP2C9 substrate | - | 0.5928 | 59.28% |
| CYP2D6 substrate | - | 0.8672 | 86.72% |
| CYP3A4 inhibition | - | 0.6690 | 66.90% |
| CYP2C9 inhibition | - | 0.9408 | 94.08% |
| CYP2C19 inhibition | - | 0.9364 | 93.64% |
| CYP2D6 inhibition | - | 0.9278 | 92.78% |
| CYP1A2 inhibition | - | 0.9435 | 94.35% |
| CYP2C8 inhibition | + | 0.5837 | 58.37% |
| CYP inhibitory promiscuity | - | 0.9871 | 98.71% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6344 | 63.44% |
| Eye corrosion | - | 0.9860 | 98.60% |
| Eye irritation | - | 0.8967 | 89.67% |
| Skin irritation | - | 0.7894 | 78.94% |
| Skin corrosion | - | 0.9398 | 93.98% |
| Ames mutagenesis | - | 0.7400 | 74.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3930 | 39.30% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | + | 0.5397 | 53.97% |
| skin sensitisation | - | 0.8786 | 87.86% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.7222 | 72.22% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | + | 0.5160 | 51.60% |
| Acute Oral Toxicity (c) | III | 0.6979 | 69.79% |
| Estrogen receptor binding | + | 0.7544 | 75.44% |
| Androgen receptor binding | + | 0.6673 | 66.73% |
| Thyroid receptor binding | - | 0.5000 | 50.00% |
| Glucocorticoid receptor binding | + | 0.6227 | 62.27% |
| Aromatase binding | + | 0.6604 | 66.04% |
| PPAR gamma | + | 0.7571 | 75.71% |
| Honey bee toxicity | - | 0.7916 | 79.16% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | + | 0.5865 | 58.65% |
| Fish aquatic toxicity | - | 0.4210 | 42.10% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.83% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.42% | 96.61% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.42% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.16% | 93.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 97.15% | 92.08% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.87% | 89.63% |
| CHEMBL4801 | P29466 | Caspase-1 | 96.13% | 96.85% |
| CHEMBL3468 | P55210 | Caspase-7 | 95.12% | 95.68% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.83% | 96.47% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.50% | 96.90% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.40% | 98.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.18% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.17% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.79% | 90.08% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 92.77% | 91.81% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.02% | 97.29% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 90.83% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.75% | 90.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.71% | 90.20% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.45% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.44% | 95.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.26% | 89.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.95% | 96.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.92% | 97.14% |
| CHEMBL2334 | P42574 | Caspase-3 | 87.24% | 98.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.07% | 90.71% |
| CHEMBL236 | P41143 | Delta opioid receptor | 86.99% | 99.35% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.94% | 97.23% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.81% | 92.32% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.77% | 92.50% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.10% | 98.33% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.88% | 97.64% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.54% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.48% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.63% | 99.23% |
| CHEMBL1949 | P62937 | Cyclophilin A | 84.53% | 98.57% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
| CHEMBL3776 | Q14790 | Caspase-8 | 83.15% | 97.06% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.74% | 94.66% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.65% | 98.03% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.41% | 98.10% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.30% | 100.00% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 81.86% | 90.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.83% | 97.09% |
| CHEMBL4374 | Q9Y5X4 | Photoreceptor-specific nuclear receptor | 81.62% | 85.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 81.45% | 97.50% |
| CHEMBL1801 | P00747 | Plasminogen | 81.23% | 92.44% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.22% | 95.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.17% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11804329 |
| LOTUS | LTS0039577 |
| wikiData | Q77369746 |