Massetolide A (WLIP/Viscosin/Massetolide molecular family)
| Internal ID | 2ad7a696-d665-4427-8e23-7c66bd3439ca |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 5-[[3,18-di(butan-2-yl)-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]amino]-4-[[2-(3-hydroxydecanoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)CC)CC(C)C)CO)CC(C)C)CO)C(C)CC)C)O |
| SMILES (Isomeric) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)CC)CC(C)C)CO)CC(C)C)CO)C(C)CC)C)O |
| InChI | InChI=1S/C55H97N9O16/c1-13-16-17-18-19-20-35(67)26-42(68)56-37(23-29(4)5)48(72)57-36(21-22-43(69)70)47(71)64-46-34(12)80-55(79)45(33(11)15-3)63-52(76)41(28-66)61-49(73)38(24-30(6)7)58-51(75)40(27-65)60-50(74)39(25-31(8)9)59-53(77)44(32(10)14-2)62-54(46)78/h29-41,44-46,65-67H,13-28H2,1-12H3,(H,56,68)(H,57,72)(H,58,75)(H,59,77)(H,60,74)(H,61,73)(H,62,78)(H,63,76)(H,64,71)(H,69,70) |
| InChI Key | JAYJEXYYCNLGOQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C55H97N9O16 |
| Molecular Weight | 1140.40 g/mol |
| Exact Mass | 1139.70532804 g/mol |
| Topological Polar Surface Area (TPSA) | 386.00 Ų |
| XlogP | 5.50 |
| Atomic LogP (AlogP) | 0.49 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 28 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5058 | 50.58% |
| Caco-2 | - | 0.8592 | 85.92% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.5577 | 55.77% |
| OATP2B1 inhibitior | - | 0.8630 | 86.30% |
| OATP1B1 inhibitior | + | 0.8186 | 81.86% |
| OATP1B3 inhibitior | + | 0.8899 | 88.99% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9301 | 93.01% |
| P-glycoprotein inhibitior | + | 0.7389 | 73.89% |
| P-glycoprotein substrate | + | 0.8703 | 87.03% |
| CYP3A4 substrate | + | 0.6940 | 69.40% |
| CYP2C9 substrate | - | 0.5928 | 59.28% |
| CYP2D6 substrate | - | 0.8672 | 86.72% |
| CYP3A4 inhibition | - | 0.6690 | 66.90% |
| CYP2C9 inhibition | - | 0.9408 | 94.08% |
| CYP2C19 inhibition | - | 0.9364 | 93.64% |
| CYP2D6 inhibition | - | 0.9278 | 92.78% |
| CYP1A2 inhibition | - | 0.9435 | 94.35% |
| CYP2C8 inhibition | + | 0.5796 | 57.96% |
| CYP inhibitory promiscuity | - | 0.9871 | 98.71% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6344 | 63.44% |
| Eye corrosion | - | 0.9860 | 98.60% |
| Eye irritation | - | 0.8967 | 89.67% |
| Skin irritation | - | 0.7894 | 78.94% |
| Skin corrosion | - | 0.9398 | 93.98% |
| Ames mutagenesis | - | 0.7700 | 77.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3847 | 38.47% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | + | 0.5522 | 55.22% |
| skin sensitisation | - | 0.8786 | 87.86% |
| Respiratory toxicity | + | 0.6889 | 68.89% |
| Reproductive toxicity | + | 0.7222 | 72.22% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | + | 0.6907 | 69.07% |
| Acute Oral Toxicity (c) | III | 0.6979 | 69.79% |
| Estrogen receptor binding | + | 0.7450 | 74.50% |
| Androgen receptor binding | + | 0.6669 | 66.69% |
| Thyroid receptor binding | - | 0.5000 | 50.00% |
| Glucocorticoid receptor binding | + | 0.6449 | 64.49% |
| Aromatase binding | + | 0.6655 | 66.55% |
| PPAR gamma | + | 0.7702 | 77.02% |
| Honey bee toxicity | - | 0.7694 | 76.94% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.5665 | 56.65% |
| Fish aquatic toxicity | - | 0.4210 | 42.10% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.77% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.16% | 96.61% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.44% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.04% | 93.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 97.20% | 92.08% |
| CHEMBL4801 | P29466 | Caspase-1 | 96.40% | 96.85% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.02% | 98.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.01% | 91.11% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.83% | 96.90% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.19% | 96.47% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.94% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.49% | 90.08% |
| CHEMBL3468 | P55210 | Caspase-7 | 92.77% | 95.68% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.63% | 89.63% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 90.90% | 96.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.73% | 91.81% |
| CHEMBL3776 | Q14790 | Caspase-8 | 90.58% | 97.06% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.41% | 97.29% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.94% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.83% | 90.20% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.13% | 89.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.65% | 95.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.40% | 97.23% |
| CHEMBL1801 | P00747 | Plasminogen | 87.72% | 92.44% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.42% | 90.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.08% | 90.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.93% | 97.14% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.42% | 94.66% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 85.29% | 90.24% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.93% | 98.10% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.82% | 99.23% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.70% | 99.35% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.30% | 92.32% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.07% | 92.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.85% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
| CHEMBL4374 | Q9Y5X4 | Photoreceptor-specific nuclear receptor | 83.22% | 85.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.12% | 93.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.70% | 100.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.45% | 97.64% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.29% | 97.50% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 82.23% | 93.85% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.11% | 97.09% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 81.67% | 96.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.65% | 94.75% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.54% | 100.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.35% | 98.03% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.10% | 94.80% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.26% | 97.25% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.25% | 92.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.19% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5232711 |
| LOTUS | LTS0122769 |
| wikiData | Q104169352 |