Masoprocol
Internal ID | 24af40b4-15cf-4702-bc86-11076b68696e |
Taxonomy | Lignans, neolignans and related compounds > Dibenzylbutane lignans |
IUPAC Name | 4-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
SMILES (Canonical) | CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O |
SMILES (Isomeric) | C[C@H](CC1=CC(=C(C=C1)O)O)[C@@H](C)CC2=CC(=C(C=C2)O)O |
InChI | InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
InChI Key | HCZKYJDFEPMADG-TXEJJXNPSA-N |
Popularity | 1,751 references in papers |
Molecular Formula | C18H22O4 |
Molecular Weight | 302.40 g/mol |
Exact Mass | 302.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 80.90 Ų |
XlogP | 4.30 |
Atomic LogP (AlogP) | 3.57 |
H-Bond Acceptor | 4 |
H-Bond Donor | 4 |
Rotatable Bonds | 5 |
meso-NDGA |
27686-84-6 |
meso-Nordihydroguaiaretic acid |
Actinex |
Masoprocolum |
Masoprocolum [INN-Latin] |
CHX 100 |
CHX-100 |
INSM18 |
meso-4,4'-(2,3-Dimethyltetramethylene)dipyrocatechol |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9578 | 95.78% |
Caco-2 | + | 0.7519 | 75.19% |
Blood Brain Barrier | - | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.8535 | 85.35% |
OATP2B1 inhibitior | - | 0.7071 | 70.71% |
OATP1B1 inhibitior | + | 0.9493 | 94.93% |
OATP1B3 inhibitior | + | 0.9316 | 93.16% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | - | 0.6765 | 67.65% |
P-glycoprotein inhibitior | - | 0.7833 | 78.33% |
P-glycoprotein substrate | - | 0.9637 | 96.37% |
CYP3A4 substrate | - | 0.7868 | 78.68% |
CYP2C9 substrate | - | 0.5629 | 56.29% |
CYP2D6 substrate | + | 0.3661 | 36.61% |
CYP3A4 inhibition | - | 0.5833 | 58.33% |
CYP2C9 inhibition | + | 0.8891 | 88.91% |
CYP2C19 inhibition | + | 0.8628 | 86.28% |
CYP2D6 inhibition | + | 0.8262 | 82.62% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.9506 | 95.06% |
CYP inhibitory promiscuity | + | 0.5322 | 53.22% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.6737 | 67.37% |
Carcinogenicity (trinary) | Non-required | 0.6290 | 62.90% |
Eye corrosion | - | 0.9663 | 96.63% |
Eye irritation | + | 0.8463 | 84.63% |
Skin irritation | - | 0.6844 | 68.44% |
Skin corrosion | - | 0.6927 | 69.27% |
Ames mutagenesis | - | 0.8700 | 87.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9060 | 90.60% |
Micronuclear | - | 0.6700 | 67.00% |
Hepatotoxicity | + | 0.9125 | 91.25% |
skin sensitisation | + | 0.5000 | 50.00% |
Respiratory toxicity | + | 0.7444 | 74.44% |
Reproductive toxicity | - | 0.5803 | 58.03% |
Mitochondrial toxicity | - | 0.6875 | 68.75% |
Nephrotoxicity | - | 0.7894 | 78.94% |
Acute Oral Toxicity (c) | III | 0.8109 | 81.09% |
Estrogen receptor binding | + | 0.7988 | 79.88% |
Androgen receptor binding | + | 0.8697 | 86.97% |
Thyroid receptor binding | + | 0.6475 | 64.75% |
Glucocorticoid receptor binding | + | 0.8063 | 80.63% |
Aromatase binding | + | 0.8289 | 82.89% |
PPAR gamma | + | 0.7519 | 75.19% |
Honey bee toxicity | - | 0.9480 | 94.80% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 1.0000 | 100.00% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
158.5 nM |
Potency |
via Super-PRED
|
CHEMBL3687 | P18054 | Arachidonate 12-lipoxygenase |
110 nM |
IC50 |
via Super-PRED
|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
100 nM 110 nM 631 nM |
Potency IC50 Potency |
via Super-PRED
via Super-PRED via Super-PRED |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
11 nM |
IC50 |
via Super-PRED
|
CHEMBL2392 | P06746 | DNA polymerase beta |
794.3 nM |
Potency |
via Super-PRED
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
125.9 nM |
Potency |
via Super-PRED
|
CHEMBL2789 | P37059 | Estradiol 17-beta-dehydrogenase 2 |
380 nM |
IC50 |
via Super-PRED
|
CHEMBL2111421 | P05412 | Transcription factor AP1 |
7.9 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.84% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.64% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.82% | 91.11% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 92.81% | 90.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.76% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.51% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.85% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.93% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.28% | 94.73% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.13% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Larrea divaricata |
Larrea tridentata |
Schisandra chinensis |
PubChem | 71398 |
LOTUS | LTS0161715 |
wikiData | Q6783851 |