Marstomentoside G
| Internal ID | b1a3a59c-ed29-49bf-b01e-6cae0faae806 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [(3S,8S,9R,10R,12R,13R,14R,17S)-8,14,17-trihydroxy-17-[(1S)-1-hydroxyethyl]-3-[(2R,4S,5R,6R)-4-methoxy-5-[(2S,4S,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-6-methyl-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2CCC3(C4CC(C5(C(CCC5(C4(CC=C3C2)O)O)(C(C)O)O)C)OC(=O)C=CC6=CC=CC=C6)C)OC)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC1CC(C(C(O1)C)OC1C(C(C(C(O1)CO)O)O)O)OC)OC)OC)OC |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@@]3([C@H]4C[C@H]([C@@]5([C@@](CC[C@@]5([C@@]4(CC=C3C2)O)O)([C@H](C)O)O)C)OC(=O)/C=C/C6=CC=CC=C6)C)OC)O[C@H]7C[C@@H]([C@@H]([C@H](O7)C)O[C@H]8C[C@H]([C@@H]([C@H](O8)C)O[C@H]9C[C@H]([C@@H]([C@H](O9)C)O[C@H]1C[C@H]([C@@H]([C@H](O1)C)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)OC)OC)OC)OC |
| InChI | InChI=1S/C71H110O27/c1-35-61(44(81-9)28-53(86-35)91-43-22-23-67(7)42(27-43)21-24-70(79)50(67)33-51(93-52(74)20-19-41-17-15-14-16-18-41)68(8)69(78,40(6)73)25-26-71(68,70)80)94-54-29-45(82-10)62(36(2)87-54)95-55-30-46(83-11)63(37(3)88-55)96-56-31-47(84-12)64(38(4)89-56)97-57-32-48(85-13)65(39(5)90-57)98-66-60(77)59(76)58(75)49(34-72)92-66/h14-21,35-40,43-51,53-66,72-73,75-80H,22-34H2,1-13H3/b20-19+/t35-,36-,37-,38-,39-,40+,43+,44+,45+,46-,47-,48-,49-,50-,51-,53+,54+,55+,56+,57+,58+,59+,60-,61-,62-,63-,64-,65-,66+,67+,68-,69-,70+,71-/m1/s1 |
| InChI Key | RETDKJVOLCMAPD-MWPTXZHESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C71H110O27 |
| Molecular Weight | 1395.60 g/mol |
| Exact Mass | 1394.72344823 g/mol |
| Topological Polar Surface Area (TPSA) | 345.00 Ų |
| XlogP | 2.80 |
| (+)-Marstomentoside G |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.51% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.31% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.30% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.00% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.67% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.57% | 85.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.51% | 96.47% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.45% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.85% | 97.09% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 92.25% | 94.23% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.15% | 94.08% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.73% | 95.50% |
| CHEMBL5028 | O14672 | ADAM10 | 90.40% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.40% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.08% | 95.93% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.84% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.22% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.79% | 95.89% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.46% | 94.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.71% | 91.07% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.10% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.47% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.16% | 93.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.20% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.02% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Marsdenia tomentosa |
| PubChem | 162967823 |
| LOTUS | LTS0133181 |
| wikiData | Q105235074 |