Maristachone C
| Internal ID | 438e067f-80a0-4be6-ac74-ec6bac0a2790 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 1-(6-ethyl-4-hydroxy-2-methoxy-3-methylphenyl)-5-hydroxy-2-methylheptan-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H28O4/c1-6-13-9-17(21)12(4)18(22-5)15(13)8-11(3)16(20)10-14(19)7-2/h9,11,14,19,21H,6-8,10H2,1-5H3 |
| InChI Key | XBTQSAVEBBVBMO-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19875937 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.40 |
| CHEMBL2335708 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.48% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.35% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.21% | 99.15% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.37% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.33% | 94.45% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.62% | 97.21% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.99% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.98% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.67% | 90.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.84% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.63% | 95.56% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.73% | 92.68% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.44% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.06% | 90.71% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 83.09% | 95.39% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.72% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.66% | 96.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.35% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71658648 |
| LOTUS | LTS0092884 |
| wikiData | Q77421579 |