Marinoquinoline D
| Internal ID | df4fc1df-f878-4671-b47c-965ba1aa24a0 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines |
| IUPAC Name | 4-(3H-pyrrolo[2,3-c]quinolin-4-ylmethyl)phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H14N2O/c21-13-7-5-12(6-8-13)11-17-18-15(9-10-19-18)14-3-1-2-4-16(14)20-17/h1-10,19,21H,11H2 |
| InChI Key | IBYIBTVYTZSSQN-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.110613074 g/mol |
| Topological Polar Surface Area (TPSA) | 48.90 Ų |
| XlogP | 3.90 |
| CHEBI:67842 |
| CHEMBL1773680 |
| BDBM50603970 |
| Q27136318 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 95.51% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.78% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.17% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.41% | 95.56% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.46% | 89.44% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.41% | 94.62% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.92% | 91.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.89% | 96.09% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.65% | 92.67% |
| CHEMBL1944 | P08473 | Neprilysin | 84.07% | 92.63% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.02% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.82% | 86.33% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.65% | 82.86% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 82.39% | 93.53% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.81% | 95.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.50% | 94.00% |
| CHEMBL3761 | Q9HCG7 | Beta-glucosidase | 80.25% | 99.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.07% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 52952005 |
| LOTUS | LTS0215667 |
| wikiData | Q27136318 |