Marinocyanin E
| Internal ID | 328cb1e0-6b79-4b86-bbad-4153765c454a |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 2-bromo-5-[(3-hydroxy-2,4,4-trimethylcyclohexen-1-yl)methyl]phenazin-1-one |
| SMILES (Canonical) | CC1=C(CCC(C1O)(C)C)CN2C3=CC=CC=C3N=C4C2=CC=C(C4=O)Br |
| SMILES (Isomeric) | CC1=C(CCC(C1O)(C)C)CN2C3=CC=CC=C3N=C4C2=CC=C(C4=O)Br |
| InChI | InChI=1S/C22H23BrN2O2/c1-13-14(10-11-22(2,3)21(13)27)12-25-17-7-5-4-6-16(17)24-19-18(25)9-8-15(23)20(19)26/h4-9,21,27H,10-12H2,1-3H3 |
| InChI Key | JREKSNBRIDHCTK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.09429 g/mol |
| Topological Polar Surface Area (TPSA) | 52.90 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.45% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.47% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.86% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.66% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.86% | 86.33% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 92.83% | 85.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.37% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.82% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.53% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.64% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.90% | 99.23% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 86.70% | 89.44% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 86.53% | 96.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.75% | 90.08% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.53% | 98.59% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.50% | 94.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.26% | 89.67% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.99% | 95.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.72% | 96.67% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.72% | 93.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.37% | 89.63% |
| CHEMBL5028 | O14672 | ADAM10 | 81.83% | 97.50% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.76% | 92.97% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.31% | 93.40% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.31% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132570353 |
| LOTUS | LTS0079496 |
| wikiData | Q105133862 |