Marinocyanin D
| Internal ID | 4a52dae7-225d-429f-a619-38c4b7f23f4d |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 2-bromo-5-[[4-(hydroxymethyl)-2,4-dimethylcyclohexen-1-yl]methyl]phenazin-1-one |
| SMILES (Canonical) | CC1=C(CCC(C1)(C)CO)CN2C3=CC=CC=C3N=C4C2=CC=C(C4=O)Br |
| SMILES (Isomeric) | CC1=C(CCC(C1)(C)CO)CN2C3=CC=CC=C3N=C4C2=CC=C(C4=O)Br |
| InChI | InChI=1S/C22H23BrN2O2/c1-14-11-22(2,13-26)10-9-15(14)12-25-18-6-4-3-5-17(18)24-20-19(25)8-7-16(23)21(20)27/h3-8,26H,9-13H2,1-2H3 |
| InChI Key | UUBGELFBAPMHPG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.09429 g/mol |
| Topological Polar Surface Area (TPSA) | 52.90 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 98.85% | 93.99% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 96.62% | 85.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.20% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.03% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.87% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.64% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.14% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.40% | 99.23% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.35% | 89.44% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.35% | 85.14% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.18% | 92.98% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.55% | 91.11% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 87.12% | 89.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.84% | 90.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.51% | 89.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.02% | 96.67% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.87% | 98.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.19% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 82.32% | 97.50% |
| CHEMBL240 | Q12809 | HERG | 82.22% | 89.76% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.20% | 94.00% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.16% | 96.25% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.00% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132570352 |
| LOTUS | LTS0134933 |
| wikiData | Q105279219 |