Marinobactin-D2
| Internal ID | 63d88050-2a90-4e5e-86c1-8763dd3f5567 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 5-[acetyl(hydroxy)amino]-2-[[2-[[5-[acetyl(hydroxy)amino]-2-[[2-[[8-[[(Z)-hexadec-7-enoyl]amino]-7-hydroxy-6,9-dioxo-1,5-diazonane-2-carbonyl]amino]-3-hydroxypropanoyl]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoic acid |
| SMILES (Canonical) | CCCCCCCCC=CCCCCCC(=O)NC1C(C(=O)NCCC(NC1=O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)O)O |
| SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCC(=O)NC1C(C(=O)NCCC(NC1=O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)O)O |
| InChI | InChI=1S/C44H75N9O16/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-21-35(58)51-36-37(59)43(65)45-23-22-31(47-42(36)64)39(61)50-33(26-54)40(62)46-30(19-17-24-52(68)28(2)56)38(60)49-34(27-55)41(63)48-32(44(66)67)20-18-25-53(69)29(3)57/h11-12,30-34,36-37,54-55,59,68-69H,4-10,13-27H2,1-3H3,(H,45,65)(H,46,62)(H,47,64)(H,48,63)(H,49,60)(H,50,61)(H,51,58)(H,66,67)/b12-11- |
| InChI Key | BERJGEGDLKQPJD-QXMHVHEDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H75N9O16 |
| Molecular Weight | 986.10 g/mol |
| Exact Mass | 985.53317734 g/mol |
| Topological Polar Surface Area (TPSA) | 383.00 Ų |
| XlogP | -0.60 |
| Atomic LogP (AlogP) | -1.86 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 33 |
| 5-[acetyl(hydroxy)amino]-2-[[2-[[5-[acetyl(hydroxy)amino]-2-[[2-[[8-[[(Z)-hexadec-7-enoyl]amino]-7-hydroxy-6,9-dioxo-1,5-diazonane-2-carbonyl]amino]-3-hydroxypropanoyl]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoic acid |
| 2-((2-((2-((1,3-dihydroxy-2-((hydroxy(6,7,9-trihydroxy-8-(((7Z)-1-hydroxyhexadec-7-en-1-ylidene)amino)-3,4,7,8-tetrahydro-2H-1,5-diazonin-2-yl)methylidene)amino)propylidene)amino)-1-hydroxy-5-(N-hydroxyacetamido)pentylidene)amino)-1,3-dihydroxypropylidene)amino)-5-(N-hydroxyacetamido)pentanoate |
| 2-{[2-({2-[(1,3-dihydroxy-2-{[hydroxy(6,7,9-trihydroxy-8-{[(7Z)-1-hydroxyhexadec-7-en-1-ylidene]amino}-3,4,7,8-tetrahydro-2H-1,5-diazonin-2-yl)methylidene]amino}propylidene)amino]-1-hydroxy-5-(N-hydroxyacetamido)pentylidene}amino)-1,3-dihydroxypropylidene]amino}-5-(N-hydroxyacetamido)pentanoate |
| 5-(acetyl(hydroxy)amino)-2-((2-((5-(acetyl(hydroxy)amino)-2-((2-((8-(((Z)-hexadec-7-enoyl)amino)-7-hydroxy-6,9-dioxo-1,5-diazonane-2-carbonyl)amino)-3-hydroxypropanoyl)amino)pentanoyl)amino)-3-hydroxypropanoyl)amino)pentanoic acid |
| RefChem:155848 |
| SCHEMBL29773772 |
| CHEBI:217238 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6453 | 64.53% |
| Caco-2 | - | 0.8588 | 85.88% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Mitochondria | 0.5406 | 54.06% |
| OATP2B1 inhibitior | - | 0.8596 | 85.96% |
| OATP1B1 inhibitior | + | 0.8195 | 81.95% |
| OATP1B3 inhibitior | + | 0.9215 | 92.15% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9129 | 91.29% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.7677 | 76.77% |
| CYP3A4 substrate | + | 0.6985 | 69.85% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8605 | 86.05% |
| CYP3A4 inhibition | + | 0.5138 | 51.38% |
| CYP2C9 inhibition | - | 0.8284 | 82.84% |
| CYP2C19 inhibition | - | 0.8055 | 80.55% |
| CYP2D6 inhibition | - | 0.8828 | 88.28% |
| CYP1A2 inhibition | - | 0.8536 | 85.36% |
| CYP2C8 inhibition | + | 0.5384 | 53.84% |
| CYP inhibitory promiscuity | - | 0.9691 | 96.91% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.7200 | 72.00% |
| Carcinogenicity (trinary) | Non-required | 0.4690 | 46.90% |
| Eye corrosion | - | 0.9808 | 98.08% |
| Eye irritation | - | 0.8980 | 89.80% |
| Skin irritation | - | 0.7582 | 75.82% |
| Skin corrosion | - | 0.9233 | 92.33% |
| Ames mutagenesis | - | 0.7832 | 78.32% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4837 | 48.37% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.5950 | 59.50% |
| skin sensitisation | - | 0.8406 | 84.06% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.8250 | 82.50% |
| Nephrotoxicity | - | 0.6086 | 60.86% |
| Acute Oral Toxicity (c) | III | 0.6169 | 61.69% |
| Estrogen receptor binding | + | 0.7643 | 76.43% |
| Androgen receptor binding | + | 0.6518 | 65.18% |
| Thyroid receptor binding | + | 0.5419 | 54.19% |
| Glucocorticoid receptor binding | + | 0.5374 | 53.74% |
| Aromatase binding | + | 0.6245 | 62.45% |
| PPAR gamma | + | 0.7020 | 70.20% |
| Honey bee toxicity | - | 0.8220 | 82.20% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | + | 0.6687 | 66.87% |
| Fish aquatic toxicity | + | 0.7726 | 77.26% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.70% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.42% | 99.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.36% | 90.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.10% | 93.56% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.50% | 94.66% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.39% | 96.61% |
| CHEMBL236 | P41143 | Delta opioid receptor | 96.29% | 99.35% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.17% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.66% | 96.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.22% | 93.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 94.83% | 95.38% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.26% | 98.33% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.84% | 97.64% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.69% | 91.81% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.51% | 90.17% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 93.22% | 98.59% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.08% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.32% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.23% | 96.47% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.03% | 91.19% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.83% | 88.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 90.73% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.12% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.45% | 95.00% |
| CHEMBL3629 | P68400 | Casein kinase II alpha | 88.79% | 98.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.38% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.33% | 99.23% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 88.12% | 98.24% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.10% | 92.08% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.48% | 97.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.25% | 94.45% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.84% | 95.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.46% | 100.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 84.25% | 97.06% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 84.09% | 95.93% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.06% | 95.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.88% | 91.03% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.77% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.10% | 96.90% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.97% | 89.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.96% | 97.50% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.74% | 97.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.59% | 82.69% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.36% | 98.10% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.26% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.22% | 97.14% |
| CHEMBL5028 | O14672 | ADAM10 | 81.80% | 97.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.54% | 90.71% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.51% | 96.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586162 |
| LOTUS | LTS0105099 |
| wikiData | Q77500377 |