Margrapine A
| Internal ID | 66af763d-6fee-45bd-a4e2-1ff26ab2ac47 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 4-[(3,3-dimethyloxiran-2-yl)-hydroxymethyl]-1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CC1(C(O1)C(C2=C(C=C(C3=C2N(C4=C(C3=O)C=CC(=C4OC)O)C)O)OC)O)C |
| SMILES (Isomeric) | CC1(C(O1)C(C2=C(C=C(C3=C2N(C4=C(C3=O)C=CC(=C4OC)O)C)O)OC)O)C |
| InChI | InChI=1S/C21H23NO7/c1-21(2)20(29-21)18(26)14-12(27-4)8-11(24)13-16(14)22(3)15-9(17(13)25)6-7-10(23)19(15)28-5/h6-8,18,20,23-24,26H,1-5H3 |
| InChI Key | LROWEGBUANNUOY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.14745207 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 2.40 |
| CHEBI:169902 |
| DTXSID301112471 |
| (-)-4-[(3,3-Dimethyl-2-oxiranyl)hydroxymethyl]-1,6-dihydroxy-3,5-dimethoxy-10-methyl-9(10H)-acridinone |
| 185417-68-9 |
| 4-[(3,3-dimethyloxiran-2-yl)-hydroxymethyl]-1,6-dihydroxy-3,5-dimethoxy-10-methylacridin-9-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.19% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.17% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.70% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.06% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.69% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.23% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.01% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.46% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.34% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.06% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.93% | 89.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.73% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.79% | 98.75% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.53% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.96% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.79% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.78% | 99.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.28% | 97.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.64% | 92.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.60% | 95.56% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.25% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus × aurantium |
| PubChem | 102003358 |
| LOTUS | LTS0094890 |
| wikiData | Q105156250 |