Margolonone
Internal ID | c0440bac-d7cd-4463-9ef9-c7a81ae00326 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4bS,8aR)-3,4b,8,8-tetramethyl-7,10-dioxo-5,6,8a,9-tetrahydrophenanthrene-2-carboxylic acid |
SMILES (Canonical) | CC1=CC2=C(C=C1C(=O)O)C(=O)CC3C2(CCC(=O)C3(C)C)C |
SMILES (Isomeric) | CC1=CC2=C(C=C1C(=O)O)C(=O)C[C@@H]3[C@@]2(CCC(=O)C3(C)C)C |
InChI | InChI=1S/C19H22O4/c1-10-7-13-12(8-11(10)17(22)23)14(20)9-15-18(2,3)16(21)5-6-19(13,15)4/h7-8,15H,5-6,9H2,1-4H3,(H,22,23)/t15-,19+/m0/s1 |
InChI Key | NWRPENOOCXAGDV-HNAYVOBHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H22O4 |
Molecular Weight | 314.40 g/mol |
Exact Mass | 314.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 71.40 Ų |
XlogP | 2.90 |
Margolonone |
12-methyl-3,7-dioxopodocarpa-8,11,13-triene-13-carboxylic acid |
DTXSID90923219 |
2-Phenanthrenecarboxylic acid, 4b,5,6,7,8,8a,9,10-octahydro-3,4b,8,8- tetramethyl-7,10-dioxo-, (4bS-trans)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 92.12% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.58% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.37% | 91.11% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.92% | 93.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.67% | 99.23% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.93% | 93.04% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.05% | 94.42% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.96% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.76% | 90.71% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.24% | 93.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.91% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.72% | 97.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.67% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.37% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.30% | 90.00% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 80.76% | 95.71% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.64% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Dalbergia sissoo |
Solanum crinitum |
PubChem | 189726 |
LOTUS | LTS0097820 |
wikiData | Q103816714 |