Marchantin A
Internal ID | 6ae2279c-272e-4d20-941b-8c68eb6fdee5 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 2,15-dioxapentacyclo[22.2.2.13,7.110,14.016,21]triaconta-1(26),3(30),4,6,10(29),11,13,16(21),17,19,24,27-dodecaene-4,5,17-triol |
SMILES (Canonical) | C1CC2=C(C(=CC=C2)O)OC3=CC=CC(=C3)CCC4=CC(=C(C(=C4)OC5=CC=C1C=C5)O)O |
SMILES (Isomeric) | C1CC2=C(C(=CC=C2)O)OC3=CC=CC(=C3)CCC4=CC(=C(C(=C4)OC5=CC=C1C=C5)O)O |
InChI | InChI=1S/C28H24O5/c29-24-6-2-4-21-12-9-18-10-13-22(14-11-18)32-26-17-20(16-25(30)27(26)31)8-7-19-3-1-5-23(15-19)33-28(21)24/h1-6,10-11,13-17,29-31H,7-9,12H2 |
InChI Key | LLMFFOXSSQHNFR-UHFFFAOYSA-N |
Popularity | 34 references in papers |
Molecular Formula | C28H24O5 |
Molecular Weight | 440.50 g/mol |
Exact Mass | 440.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 79.20 Ų |
XlogP | 6.40 |
CHEBI:6693 |
CHEMBL2040589 |
DTXSID101317897 |
Q27107299 |
2,15-dioxapentacyclo[22.2.2.13,7.110,14.016,21]triaconta-1(26),3(30),4,6,10(29),11,13,16(21),17,19,24,27-dodecaene-4,5,17-triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.32% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.75% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.65% | 93.99% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.15% | 93.40% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 86.16% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.41% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.10% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.97% | 94.00% |
CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 81.86% | 97.90% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.28% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.93% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Marchantia paleacea |
Marchantia polymorpha |
Radula perrottetii |
Wiesnerella denudata |
PubChem | 442710 |
NPASS | NPC66840 |
ChEMBL | CHEMBL2040589 |
LOTUS | LTS0019106 |
wikiData | Q27107299 |