Manassantin B1
Internal ID | 2f9c06d7-694f-435f-aeac-0932664a76ce |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,7-epoxylignans |
IUPAC Name | 2-[(1R,2R)-1-(3,4-dimethoxyphenyl)-1-hydroxypropan-2-yl]oxy-5-[(2S,3R,4R,5S)-5-[4-[(1R,2R)-1-(3,4-dimethoxyphenyl)-1-hydroxypropan-2-yl]oxy-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]phenol |
SMILES (Canonical) | CC1C(C(OC1C2=CC(=C(C=C2)OC(C)C(C3=CC(=C(C=C3)OC)OC)O)O)C4=CC(=C(C=C4)OC(C)C(C5=CC(=C(C=C5)OC)OC)O)OC)C |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@H](O[C@@H]1C2=CC(=C(C=C2)O[C@H](C)[C@@H](C3=CC(=C(C=C3)OC)OC)O)O)C4=CC(=C(C=C4)O[C@H](C)[C@@H](C5=CC(=C(C=C5)OC)OC)O)OC)C |
InChI | InChI=1S/C41H50O11/c1-22-23(2)41(29-13-17-34(37(21-29)49-9)51-25(4)39(44)27-11-16-33(46-6)36(20-27)48-8)52-40(22)28-12-14-31(30(42)18-28)50-24(3)38(43)26-10-15-32(45-5)35(19-26)47-7/h10-25,38-44H,1-9H3/t22-,23-,24-,25-,38+,39+,40+,41+/m1/s1 |
InChI Key | BHSIFEWQADUTCG-FZBBBUCASA-N |
Popularity | 20 references in papers |
Molecular Formula | C41H50O11 |
Molecular Weight | 718.80 g/mol |
Exact Mass | 718.33531241 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 6.50 |
CHEMBL2021442 |
BDBM50498799 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.44% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.71% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.45% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.52% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.68% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.52% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.89% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.63% | 95.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.99% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.43% | 99.15% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.30% | 97.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.22% | 92.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.77% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 84.27% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.02% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.54% | 99.17% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.96% | 96.86% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.86% | 93.99% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 81.00% | 90.20% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.84% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.34% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Saururus chinensis |
PubChem | 70685494 |
NPASS | NPC470372 |
ChEMBL | CHEMBL2021442 |
LOTUS | LTS0033628 |
wikiData | Q104936199 |