Maltacine D1a
| Internal ID | fa049ce1-f5fa-4338-b451-28563aaa4e4c |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 3-[27-[[2-[[5-amino-5-oxo-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-12-(3-aminopropyl)-3-butan-2-yl-9,29-dihydroxy-18-(1-hydroxyethyl)-6,15-bis[(4-hydroxyphenyl)methyl]-24-methyl-2,5,8,11,14,17,20,23,26-nonaoxo-1-oxa-4,7,10,13,16,19,22,25-octazacyclotriacont-21-yl]propanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)OCC(CC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)O)CCCN)CC3=CC=C(C=C3)O)C(C)O)CCC(=O)O)C)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)C(CCC(=O)N)NC(=O)C5CCCN5)O |
| SMILES (Isomeric) | CCC(C)C1C(=O)OCC(CC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)O)CCCN)CC3=CC=C(C=C3)O)C(C)O)CCC(=O)O)C)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)C(CCC(=O)N)NC(=O)[C@@H]5CCCN5)O |
| InChI | InChI=1S/C67H94N14O22/c1-5-33(2)53-67(102)103-32-42(86)31-50(76-62(97)47(28-36-10-16-39(83)17-11-36)75-57(92)45(22-24-51(69)87)74-56(91)43-9-7-27-70-43)60(95)71-34(3)55(90)72-46(23-25-52(88)89)58(93)80-54(35(4)82)64(99)77-48(29-37-12-18-40(84)19-13-37)61(96)73-44(8-6-26-68)59(94)81-66(101)65(100)78-49(63(98)79-53)30-38-14-20-41(85)21-15-38/h10-21,33-35,42-50,53-54,66,70,82-86,101H,5-9,22-32,68H2,1-4H3,(H2,69,87)(H,71,95)(H,72,90)(H,73,96)(H,74,91)(H,75,92)(H,76,97)(H,77,99)(H,78,100)(H,79,98)(H,80,93)(H,81,94)(H,88,89)/t33?,34?,35?,42?,43-,44?,45?,46?,47?,48?,49?,50?,53?,54?,66?/m0/s1 |
| InChI Key | NVQSOBYWDGPCAF-LMMNZZMASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C67H94N14O22 |
| Molecular Weight | 1447.50 g/mol |
| Exact Mass | 1446.66671068 g/mol |
| Topological Polar Surface Area (TPSA) | 586.00 Ų |
| XlogP | -3.90 |
| Atomic LogP (AlogP) | -5.51 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 21 |
| Rotatable Bonds | 24 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4697 | 46.97% |
| Caco-2 | - | 0.8623 | 86.23% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Nucleus | 0.4601 | 46.01% |
| OATP2B1 inhibitior | - | 0.8613 | 86.13% |
| OATP1B1 inhibitior | + | 0.8304 | 83.04% |
| OATP1B3 inhibitior | + | 0.9359 | 93.59% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9392 | 93.92% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8901 | 89.01% |
| CYP3A4 substrate | + | 0.7446 | 74.46% |
| CYP2C9 substrate | - | 0.7973 | 79.73% |
| CYP2D6 substrate | - | 0.8122 | 81.22% |
| CYP3A4 inhibition | - | 0.7084 | 70.84% |
| CYP2C9 inhibition | - | 0.9133 | 91.33% |
| CYP2C19 inhibition | - | 0.8821 | 88.21% |
| CYP2D6 inhibition | - | 0.8708 | 87.08% |
| CYP1A2 inhibition | - | 0.9213 | 92.13% |
| CYP2C8 inhibition | + | 0.7978 | 79.78% |
| CYP inhibitory promiscuity | - | 0.8934 | 89.34% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8200 | 82.00% |
| Carcinogenicity (trinary) | Non-required | 0.6162 | 61.62% |
| Eye corrosion | - | 0.9889 | 98.89% |
| Eye irritation | - | 0.8958 | 89.58% |
| Skin irritation | - | 0.7830 | 78.30% |
| Skin corrosion | - | 0.9337 | 93.37% |
| Ames mutagenesis | - | 0.7337 | 73.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7284 | 72.84% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | - | 0.5250 | 52.50% |
| skin sensitisation | - | 0.8710 | 87.10% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9484 | 94.84% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | - | 0.6672 | 66.72% |
| Acute Oral Toxicity (c) | III | 0.6622 | 66.22% |
| Estrogen receptor binding | + | 0.5932 | 59.32% |
| Androgen receptor binding | + | 0.7597 | 75.97% |
| Thyroid receptor binding | + | 0.6958 | 69.58% |
| Glucocorticoid receptor binding | + | 0.7776 | 77.76% |
| Aromatase binding | + | 0.7337 | 73.37% |
| PPAR gamma | + | 0.7720 | 77.20% |
| Honey bee toxicity | - | 0.6859 | 68.59% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
| Fish aquatic toxicity | + | 0.6943 | 69.43% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.94% | 96.61% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 99.89% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.77% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.68% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 99.32% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.30% | 97.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.14% | 94.45% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 97.86% | 95.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.42% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.37% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 97.10% | 90.20% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.70% | 97.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.46% | 90.08% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 95.38% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.29% | 99.35% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.69% | 93.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.68% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.16% | 97.14% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 94.02% | 97.64% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 93.89% | 98.35% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.75% | 96.47% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 93.62% | 96.67% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 93.51% | 95.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.80% | 90.71% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 92.36% | 88.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.58% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.44% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.99% | 93.00% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 90.70% | 94.55% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.55% | 98.05% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 90.22% | 97.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.15% | 85.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.93% | 95.89% |
| CHEMBL1801 | P00747 | Plasminogen | 89.27% | 92.44% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.02% | 82.69% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.64% | 95.93% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 88.57% | 98.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.42% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.41% | 95.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.36% | 95.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.78% | 91.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.44% | 89.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.87% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.55% | 96.90% |
| CHEMBL2821 | P00748 | Coagulation factor XII | 85.24% | 96.21% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.85% | 94.75% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 84.51% | 98.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.35% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.29% | 92.88% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.21% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.92% | 97.25% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 83.63% | 96.11% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.55% | 96.33% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.38% | 85.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.27% | 88.56% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.65% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.47% | 97.21% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.43% | 98.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.15% | 100.00% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 80.92% | 97.79% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 80.79% | 98.00% |
| CHEMBL4633 | P22001 | Voltage-gated potassium channel subunit Kv1.3 | 80.64% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.51% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139583777 |
| LOTUS | LTS0009554 |
| wikiData | Q75067360 |