malonganenon H
| Internal ID | f9f06a46-dfe0-4b22-b6a4-9aa3b91eb88c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Acyclic diterpenoids |
| IUPAC Name | N-[(2E,6E,11E)-3,7,11,15-tetramethyl-13-oxohexadeca-2,6,11-trienyl]formamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C21H35NO2/c1-17(2)14-21(24)15-20(5)11-7-9-18(3)8-6-10-19(4)12-13-22-16-23/h8,12,15-17H,6-7,9-11,13-14H2,1-5H3,(H,22,23)/b18-8+,19-12+,20-15+ |
| InChI Key | HWWWXUSKGJVFKD-JWZAADIXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.266779359 g/mol |
| Topological Polar Surface Area (TPSA) | 46.20 Ų |
| XlogP | 5.70 |
| CHEMBL229706 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.58% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.52% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.61% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.46% | 91.11% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.89% | 97.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.02% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.44% | 96.47% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.58% | 100.00% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 86.00% | 87.16% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.80% | 94.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.27% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.75% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.18% | 94.73% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 83.07% | 95.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.77% | 95.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.24% | 96.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.84% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16756549 |
| LOTUS | LTS0081967 |
| wikiData | Q105034858 |