Macrosporusone D
Internal ID | 2c1f80f5-00a7-4280-96d5-f690146e6971 |
Taxonomy | Benzenoids > Dibenzocycloheptenes |
IUPAC Name | (1S,14R,24S)-3,9,19,24-tetrahydroxy-5-methoxy-17-methyl-6,22-dioxaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),3,8,10,12(26),16(25),17,19-octaene-7,15,21-trione |
SMILES (Canonical) | CC1=CC(=C2C3=C1C(=O)C4C(C3(COC2=O)C5=C4C6=C7C(=C5O)C(OC(=O)C7=C(C=C6)O)OC)O)O |
SMILES (Isomeric) | CC1=CC(=C2C3=C1C(=O)[C@H]4[C@@H]([C@]3(COC2=O)C5=C4C6=C7C(=C5O)C(OC(=O)C7=C(C=C6)O)OC)O)O |
InChI | InChI=1S/C26H18O10/c1-7-5-10(28)15-18-11(7)20(29)16-13-8-3-4-9(27)14-12(8)17(25(34-2)36-24(14)33)21(30)19(13)26(18,22(16)31)6-35-23(15)32/h3-5,16,22,25,27-28,30-31H,6H2,1-2H3/t16-,22-,25?,26-/m0/s1 |
InChI Key | WZJUDSHVYVPUAR-WSIOJEQCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H18O10 |
Molecular Weight | 490.40 g/mol |
Exact Mass | 490.08999677 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.01% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.85% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.59% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.04% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.59% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.19% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.64% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.50% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.36% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.27% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.54% | 93.99% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.96% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.28% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.85% | 94.73% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.17% | 93.03% |
CHEMBL2535 | P11166 | Glucose transporter | 83.23% | 98.75% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.78% | 83.10% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.33% | 92.62% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.09% | 96.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.86% | 92.94% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.60% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
PubChem | 146683386 |
LOTUS | LTS0077070 |
wikiData | Q104888735 |