Macrocalyxoformin A
Internal ID | 63da36c7-4f30-44a0-bc34-386a342524d1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (1S,2S,5R,7R,8S,11S,14R,17S,20R)-7-hydroxy-14-methyl-6-methylidene-10,16,18-trioxahexacyclo[12.5.1.15,8.01,11.02,8.017,20]henicosan-9-one |
SMILES (Canonical) | CC12CCC3C4(C1C(OC2)OC4)C5CCC6CC5(C(C6=C)O)C(=O)O3 |
SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@]4([C@@H]1[C@@H](OC2)OC4)[C@@H]5CC[C@@H]6C[C@]5([C@@H](C6=C)O)C(=O)O3 |
InChI | InChI=1S/C20H26O5/c1-10-11-3-4-12-19(7-11,15(10)21)17(22)25-13-5-6-18(2)8-23-16-14(18)20(12,13)9-24-16/h11-16,21H,1,3-9H2,2H3/t11-,12-,13+,14-,15-,16+,18+,19+,20-/m1/s1 |
InChI Key | QALWKTNRDDDECH-FUNDCJPPSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H26O5 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 1.60 |
85287-58-7 |
(1S,2S,5R,7R,8S,11S,14R,17S,20R)-7-hydroxy-14-methyl-6-methylidene-10,16,18-trioxahexacyclo[12.5.1.15,8.01,11.02,8.017,20]henicosan-9-one |
Enmein, 1-deoxo-10,13-dideoxy-10,21-epoxy-1-hydroxy-, (1alpha,10S,12alpha)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.11% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.32% | 97.25% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.42% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.49% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.04% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.90% | 90.17% |
CHEMBL4072 | P07858 | Cathepsin B | 87.64% | 93.67% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.90% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.34% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.72% | 92.94% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.07% | 97.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.45% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 84.36% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.25% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.70% | 96.43% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.00% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
Isodon sculponeatus |
PubChem | 10247031 |
LOTUS | LTS0227113 |
wikiData | Q105217512 |